(+)-2,2'-isopropylidenebis[(4R)-4-phenyl-2-oxazoline]


(+)-2,2'-isopropylidenebis[(4R)-4-phenyl-2-oxazoline]
CAS:[150529-93-4]
Formula:C21H22N2O2; 334.42 g/mol
InChiKey:JTNVCJCSECAMLD-ROUUACIJSA-N
SMILES:CC(C)(C1=N[C@@H](CO1)c2ccccc2)C3=N[C@@H](CO3)c4ccccc4
Molecular structure of (+)-2,2'-isopropylidenebis[(4R)-4-phenyl-2-oxazoline]
Melting point:57 °C

Isomers

(+)-2,2'-isopropylidenebis[(4R)-4-phenyl-2-oxazoline]
Molecular structure of (+)-2,2'-isopropylidenebis[(4R)-4-phenyl-2-oxazoline]
(-)-2,2'-isopropylidenebis[(4S)-4-phenyl-2-oxazoline]
Molecular structure of (-)-2,2'-isopropylidenebis[(4S)-4-phenyl-2-oxazoline]
strychnine
Molecular structure of strychnine