(5R)-2-isopropylidene-5-methylcyclohexanone; (+)-pulegone; (R)-(+)-pulegone; pulegone |
Links: | 🌍 Wikipedia, ⚗️ ChemSynthesis, 📖 PubMed |
CAS RN: | [89-82-7] |
Formula: | C10H16O; 152.24 g/mol
|
InChiKey: | NZGWDASTMWDZIW-MRVPVSSYSA-N |
SMILES: | C[C@@H]1CCC(=C(C)C)C(=O)C1 |
![Molecular structure of (5R)-2-isopropylidene-5-methylcyclohexanone](mol2svg.php?id=2440&w=6&h=6) |
Use: | synthetic peppermint compounds |
Odor: | main fragrance of fleabane oil |
Density: | 0.937 g/mL |
Molar volume: | 162.5 mL/mol |
Refractive index: | 1.487 |
Molecular refractive power: | 46.73 mL/mol |
Dielectric constant: | 9.50 |
Dipole moment: | 2.95 D |
Melting point: | 25 °C |
Boiling point: | 224 °C |
Log10 partition octanol / water: | 3.08 |