1,3-indanedione


1,3-indandione; 1,3-indanedione; indane-1,3-dione; indene-1,3-dione
Links:📖 PubMed
CAS:[606-23-5]
Formula:C9H6O2; 146.15 g/mol
InChiKey:UHKAJLSKXBADFT-UHFFFAOYSA-N
SMILES:O=C1CC(=O)c2ccccc12
Molecular structure of 1,3-indanedione
Density:1.370 g/mL
Molar volume:106.7 mL/mol
Dipole moment:2.73 D
Melting point:130 °C
Log10 partition octanol / water:0.61

Isomers

1-benzocyclobutenecarboxylic acid
Molecular structure of 1-benzocyclobutenecarboxylic acid
2-benzofurancarboxaldehyde
Molecular structure of 2-benzofurancarboxaldehyde
chromone
Molecular structure of chromone
coumarin
Molecular structure of coumarin
5-ethynyl-1,3-benzodioxole
Molecular structure of 5-ethynyl-1,3-benzodioxole
4-ethynylbenzoic acid
Molecular structure of 4-ethynylbenzoic acid
indan-1,2-dione
Molecular structure of indan-1,2-dione
1,3-indanedione
Molecular structure of 1,3-indanedione
isochromen-1-one
Molecular structure of isochromen-1-one
2-methylbicyclo[4.2.0]octa-1,3,5-triene-7,8-dione
Molecular structure of 2-methylbicyclo[4.2.0]octa-1,3,5-triene-7,8-dione
phenylpropynoic acid
Molecular structure of phenylpropynoic acid