2,3-pyridinedicarboxylic acid


2,3-pyridinedicarboxylic acid; pyridine-2,3-dicarboxylic acid; quinolinic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[89-00-9]
Formula:C7H5NO4; 167.12 g/mol
InChiKey:GJAWHXHKYYXBSV-UHFFFAOYSA-N
SMILES:OC(=O)c1cccnc1C(O)=O
Molecular structure of 2,3-pyridinedicarboxylic acid
Dipole moment:6.20 D
Melting point:229 °C

Isomers

2-hydroxy-3-nitrobenzaldehyde
Molecular structure of 2-hydroxy-3-nitrobenzaldehyde
2-hydroxy-4-nitrobenzaldehyde
Molecular structure of 2-hydroxy-4-nitrobenzaldehyde
2-hydroxy-5-nitrobenzaldehyde
Molecular structure of 2-hydroxy-5-nitrobenzaldehyde
3-hydroxy-4-nitrobenzaldehyde
Molecular structure of 3-hydroxy-4-nitrobenzaldehyde
4-hydroxy-3-nitrobenzaldehyde
Molecular structure of 4-hydroxy-3-nitrobenzaldehyde
5-hydroxy-2-nitrobenzaldehyde
Molecular structure of 5-hydroxy-2-nitrobenzaldehyde
1,2-methylenedioxy-4-nitrobenzene
Molecular structure of 1,2-methylenedioxy-4-nitrobenzene
2-nitrobenzoic acid
Molecular structure of 2-nitrobenzoic acid
3-nitrobenzoic acid
Molecular structure of 3-nitrobenzoic acid
4-nitrobenzoic acid
Molecular structure of 4-nitrobenzoic acid
(E)-3-(5-nitro-2-furanyl)-2-propenal
Molecular structure of (E)-3-(5-nitro-2-furanyl)-2-propenal
4-nitrophenyl formate
Molecular structure of 4-nitrophenyl formate
2,3-pyridinedicarboxylic acid
Molecular structure of 2,3-pyridinedicarboxylic acid
pyridine-2,4-dicarboxylic acid
Molecular structure of pyridine-2,4-dicarboxylic acid
pyridine-2,5-dicarboxylic acid
Molecular structure of pyridine-2,5-dicarboxylic acid
2,6-pyridinedicarboxylic acid
Molecular structure of 2,6-pyridinedicarboxylic acid
pyridine-3,4-dicarboxylic acid
Molecular structure of pyridine-3,4-dicarboxylic acid
3,5-pyridinedicarboxylic acid
Molecular structure of 3,5-pyridinedicarboxylic acid