3,8-diethyldecane


3,8-diethyldecane
CAS:[6224-52-8]
Formula:C14H30; 198.39 g/mol
InChiKey:TVHORVYWMYKNLR-UHFFFAOYSA-N
SMILES:CCC(CC)CCCCC(CC)CC
Molecular structure of 3,8-diethyldecane
Density:0.778 g/mL
Molar volume:255.1 mL/mol
Refractive index:1.436
Molecular refractive power:66.65 mL/mol
Melting point:-48 °C
Boiling point:235 °C

Isomers

3,8-diethyldecane
Molecular structure of 3,8-diethyldecane
2,11-dimethyldodecane
Molecular structure of 2,11-dimethyldodecane
2,2-dimethyldodecane
Molecular structure of 2,2-dimethyldodecane
4,4-dipropyloctane
Molecular structure of 4,4-dipropyloctane
4,5-dipropyloctane
Molecular structure of 4,5-dipropyloctane
2-methyl-5-propyldecane
Molecular structure of 2-methyl-5-propyldecane
2-methyltridecane
Molecular structure of 2-methyltridecane
3-methyltridecane
Molecular structure of 3-methyltridecane
7-methyltridecane
Molecular structure of 7-methyltridecane
tetradecane
Molecular structure of tetradecane
2,2,9,9-tetramethyldecane
Molecular structure of 2,2,9,9-tetramethyldecane
2,6,10-trimethylhendecane
Molecular structure of 2,6,10-trimethylhendecane