3-hydroxyphenylacetic acid


m-hydroxyphenylacetic acid; (3-hydroxyphenyl)acetic acid; 3-hydroxyphenylacetic acid
Links:📖 PubMed
CAS:[621-37-4]
Formula:C8H8O3; 152.15 g/mol
InChiKey:FVMDYYGIDFPZAX-UHFFFAOYSA-N
SMILES:OC(=O)Cc1cccc(O)c1
Molecular structure of 3-hydroxyphenylacetic acid
Melting point:130 °C
Log10 partition octanol / water:0.85

Isomers

allyl 2-furoate
Molecular structure of allyl 2-furoate
anti-3-oxotricyclo[2.2.1.02,6]heptane-7-carboxylic acid
Molecular structure of anti-3-oxotricyclo[2.2.1.02,6]heptane-7-carboxylic acid
cis-4-cyclohexene-1,2-dicarboxylic anhydride
Molecular structure of cis-4-cyclohexene-1,2-dicarboxylic anhydride
2,5-dihydroxyacetophenone
Molecular structure of 2,5-dihydroxyacetophenone
2,6-dihydroxyacetophenone
Molecular structure of 2,6-dihydroxyacetophenone
2',4'-dihydroxyacetophenone
Molecular structure of 2',4'-dihydroxyacetophenone
3',5'-dihydroxyacetophenone
Molecular structure of 3',5'-dihydroxyacetophenone
2,4-dihydroxy-6-methylbenzaldehyde
Molecular structure of 2,4-dihydroxy-6-methylbenzaldehyde
1-(3,4-dihydroxyphenyl)ethanone
Molecular structure of 1-(3,4-dihydroxyphenyl)ethanone
1-furan-2-ylbutane-1,2-dione
Molecular structure of 1-furan-2-ylbutane-1,2-dione
2-hydroxy-3-methoxybenzaldehyde
Molecular structure of 2-hydroxy-3-methoxybenzaldehyde
2-hydroxy-4-methoxybenzaldehyde
Molecular structure of 2-hydroxy-4-methoxybenzaldehyde
2-hydroxy-5-methoxybenzaldehyde
Molecular structure of 2-hydroxy-5-methoxybenzaldehyde
2-hydroxy-6-methoxybenzaldehyde
Molecular structure of 2-hydroxy-6-methoxybenzaldehyde
3-hydroxy-4-methoxybenzaldehyde
Molecular structure of 3-hydroxy-4-methoxybenzaldehyde
4-hydroxy-2-methoxybenzaldehyde
Molecular structure of 4-hydroxy-2-methoxybenzaldehyde
4-hydroxy-3-methoxybenzaldehyde
Molecular structure of 4-hydroxy-3-methoxybenzaldehyde
2-(hydroxymethyl)benzoic acid
Molecular structure of 2-(hydroxymethyl)benzoic acid
2-hydroxy-3-methylbenzoic acid
Molecular structure of 2-hydroxy-3-methylbenzoic acid
2-hydroxy-4-methylbenzoic acid
Molecular structure of 2-hydroxy-4-methylbenzoic acid
2-hydroxy-5-methylbenzoic acid
Molecular structure of 2-hydroxy-5-methylbenzoic acid
2-hydroxy-6-methylbenzoic acid
Molecular structure of 2-hydroxy-6-methylbenzoic acid
3-(hydroxymethyl)benzoic acid
Molecular structure of 3-(hydroxymethyl)benzoic acid
3-hydroxy-2-methylbenzoic acid
Molecular structure of 3-hydroxy-2-methylbenzoic acid
3-hydroxy-4-methylbenzoic acid
Molecular structure of 3-hydroxy-4-methylbenzoic acid
4-(hydroxymethyl)benzoic acid
Molecular structure of 4-(hydroxymethyl)benzoic acid
4-hydroxy-2-methylbenzoic acid
Molecular structure of 4-hydroxy-2-methylbenzoic acid
4-hydroxy-3-methylbenzoic acid
Molecular structure of 4-hydroxy-3-methylbenzoic acid
5-hydroxy-2-methylbenzoic acid
Molecular structure of 5-hydroxy-2-methylbenzoic acid
5-hydroxy-3-methylbenzoic acid
Molecular structure of 5-hydroxy-3-methylbenzoic acid
2-hydroxyphenyl acetate
Molecular structure of 2-hydroxyphenyl acetate
3-hydroxyphenyl acetate
Molecular structure of 3-hydroxyphenyl acetate
4-hydroxyphenyl acetate
Molecular structure of 4-hydroxyphenyl acetate
2-hydroxyphenylacetic acid
Molecular structure of 2-hydroxyphenylacetic acid
2-hydroxy-2-phenylacetic acid
Molecular structure of 2-hydroxy-2-phenylacetic acid
3-hydroxyphenylacetic acid
Molecular structure of 3-hydroxyphenylacetic acid
4-hydroxyphenylacetic acid
Molecular structure of 4-hydroxyphenylacetic acid
(R)-mandelic acid
Molecular structure of (R)-mandelic acid
(S)-mandelic acid
Molecular structure of (S)-mandelic acid
2-methoxybenzoic acid
Molecular structure of 2-methoxybenzoic acid
3-methoxybenzoic acid
Molecular structure of 3-methoxybenzoic acid
4-methoxybenzoic acid
Molecular structure of 4-methoxybenzoic acid
3,4-(methylenedioxy)benzyl alcohol
Molecular structure of 3,4-(methylenedioxy)benzyl alcohol
methyl (E)-3-furan-2-ylprop-2-enoate
Molecular structure of methyl (E)-3-furan-2-ylprop-2-enoate
methyl 2-hydroxybenzoate
Molecular structure of methyl 2-hydroxybenzoate
methyl 3-hydroxybenzoate
Molecular structure of methyl 3-hydroxybenzoate
methyl 4-hydroxybenzoate
Molecular structure of methyl 4-hydroxybenzoate
methyl phenyl carbonate
Molecular structure of methyl phenyl carbonate
phenoxyacetic acid
Molecular structure of phenoxyacetic acid
phenylglyoxal hydrate
Molecular structure of phenylglyoxal hydrate
4,5,6,7-tetrahydroisobenzofuran-1,3-dione
Molecular structure of 4,5,6,7-tetrahydroisobenzofuran-1,3-dione