4-methoxy-3-nitrobenzoic acid


4-methoxy-3-nitrobenzoic acid
CAS:[89-41-8]
Formula:C8H7NO5; 197.15 g/mol
InChiKey:ANXBDAFDZSXOPQ-UHFFFAOYSA-N
SMILES:COc1ccc(cc1[N+]([O-])=O)C(O)=O
Molecular structure of 4-methoxy-3-nitrobenzoic acid
Melting point:188 °C

Isomers

2-hydroxy-3-methoxy-5-nitrobenzaldehyde
Molecular structure of 2-hydroxy-3-methoxy-5-nitrobenzaldehyde
2-hydroxy-5-methoxy-3-nitrobenzaldehyde
Molecular structure of 2-hydroxy-5-methoxy-3-nitrobenzaldehyde
4-hydroxy-3-methoxy-5-nitrobenzaldehyde
Molecular structure of 4-hydroxy-3-methoxy-5-nitrobenzaldehyde
3-hydroxy-4-methyl-2-nitrobenzoic acid
Molecular structure of 3-hydroxy-4-methyl-2-nitrobenzoic acid
4-hydroxy-3-nitrophenylacetic acid
Molecular structure of 4-hydroxy-3-nitrophenylacetic acid
2-methoxy-4-nitrobenzoic acid
Molecular structure of 2-methoxy-4-nitrobenzoic acid
2-methoxy-5-nitrobenzoic acid
Molecular structure of 2-methoxy-5-nitrobenzoic acid
3-methoxy-2-nitrobenzoic acid
Molecular structure of 3-methoxy-2-nitrobenzoic acid
3-methoxy-4-nitrobenzoic acid
Molecular structure of 3-methoxy-4-nitrobenzoic acid
4-methoxy-2-nitrobenzoic acid
Molecular structure of 4-methoxy-2-nitrobenzoic acid
4-methoxy-3-nitrobenzoic acid
Molecular structure of 4-methoxy-3-nitrobenzoic acid
5-methoxy-2-nitrobenzoic acid
Molecular structure of 5-methoxy-2-nitrobenzoic acid
methyl 2-hydroxy-3-nitrobenzoate
Molecular structure of methyl 2-hydroxy-3-nitrobenzoate
methyl 2-hydroxy-5-nitrobenzoate
Molecular structure of methyl 2-hydroxy-5-nitrobenzoate
methyl 3-hydroxy-4-nitrobenzoate
Molecular structure of methyl 3-hydroxy-4-nitrobenzoate
methyl 4-hydroxy-3-nitrobenzoate
Molecular structure of methyl 4-hydroxy-3-nitrobenzoate
(6-nitro-1,3-benzodioxol-5-yl)methanol
Molecular structure of (6-nitro-1,3-benzodioxol-5-yl)methanol
2-nitrophenoxyacetic acid
Molecular structure of 2-nitrophenoxyacetic acid
3-nitrophenoxyacetic acid
Molecular structure of 3-nitrophenoxyacetic acid
4-nitrophenoxyacetic acid
Molecular structure of 4-nitrophenoxyacetic acid