4-methyl-1,2-benzoquinone


4-methyl-1,2-benzoquinone; o-toluquinone
CAS:[3131-54-2]
Formula:C7H6O2; 122.12 g/mol
InChiKey:GYEMOVUSSDZYLQ-UHFFFAOYSA-N
SMILES:CC1=CC(=O)C(=O)C=C1
Molecular structure of 4-methyl-1,2-benzoquinone
Melting point:195 °C

Isomers

benzoic acid
Molecular structure of benzoic acid
(E)-3-furan-2-ylprop-2-enal
Molecular structure of (E)-3-furan-2-ylprop-2-enal
3-hydroxybenzaldehyde
Molecular structure of 3-hydroxybenzaldehyde
4-hydroxybenzaldehyde
Molecular structure of 4-hydroxybenzaldehyde
2-hydroxy-2,4,6-cycloheptatrien-1-one
Molecular structure of 2-hydroxy-2,4,6-cycloheptatrien-1-one
2-methyl-1,4-benzoquinone
Molecular structure of 2-methyl-1,4-benzoquinone
4-methyl-1,2-benzoquinone
Molecular structure of 4-methyl-1,2-benzoquinone
1,2-methylenedioxybenzene
Molecular structure of 1,2-methylenedioxybenzene
phenyl formate
Molecular structure of phenyl formate
salicylaldehyde
Molecular structure of salicylaldehyde