5-hydroxy-2-nitrobenzaldehyde


5-hydroxy-2-nitrobenzaldehyde
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[42454-06-8]
Formula:C7H5NO4; 167.12 g/mol
InChiKey:XLYPHUGUKGMURE-UHFFFAOYSA-N
SMILES:Oc1ccc(c(C=O)c1)[N+]([O-])=O
Molecular structure of 5-hydroxy-2-nitrobenzaldehyde
Melting point:167 °C
Log10 partition octanol / water:1.75

Isomers

2-hydroxy-3-nitrobenzaldehyde
Molecular structure of 2-hydroxy-3-nitrobenzaldehyde
2-hydroxy-4-nitrobenzaldehyde
Molecular structure of 2-hydroxy-4-nitrobenzaldehyde
2-hydroxy-5-nitrobenzaldehyde
Molecular structure of 2-hydroxy-5-nitrobenzaldehyde
3-hydroxy-4-nitrobenzaldehyde
Molecular structure of 3-hydroxy-4-nitrobenzaldehyde
4-hydroxy-3-nitrobenzaldehyde
Molecular structure of 4-hydroxy-3-nitrobenzaldehyde
5-hydroxy-2-nitrobenzaldehyde
Molecular structure of 5-hydroxy-2-nitrobenzaldehyde
1,2-methylenedioxy-4-nitrobenzene
Molecular structure of 1,2-methylenedioxy-4-nitrobenzene
2-nitrobenzoic acid
Molecular structure of 2-nitrobenzoic acid
3-nitrobenzoic acid
Molecular structure of 3-nitrobenzoic acid
4-nitrobenzoic acid
Molecular structure of 4-nitrobenzoic acid
(E)-3-(5-nitro-2-furanyl)-2-propenal
Molecular structure of (E)-3-(5-nitro-2-furanyl)-2-propenal
4-nitrophenyl formate
Molecular structure of 4-nitrophenyl formate
2,3-pyridinedicarboxylic acid
Molecular structure of 2,3-pyridinedicarboxylic acid
pyridine-2,4-dicarboxylic acid
Molecular structure of pyridine-2,4-dicarboxylic acid
pyridine-2,5-dicarboxylic acid
Molecular structure of pyridine-2,5-dicarboxylic acid
2,6-pyridinedicarboxylic acid
Molecular structure of 2,6-pyridinedicarboxylic acid
pyridine-3,4-dicarboxylic acid
Molecular structure of pyridine-3,4-dicarboxylic acid
3,5-pyridinedicarboxylic acid
Molecular structure of 3,5-pyridinedicarboxylic acid