6,6-dimethylbicyclo[3.1.1]heptan-2-one


6,6-dimethylbicyclo[3.1.1]heptan-2-one; nopinon
Links:
📖Houben-Weyl, 2. Band (Nopinon); p. 122,
Formula:C9H14O; 138.21 g/mol
InChiKey:XZFDKWMYCUEKSS-UHFFFAOYSA-N
SMILES:CC1(C)C2CCC(=O)C1C2
Molecular structure of 6,6-dimethylbicyclo[3.1.1]heptan-2-one

Isomers

Molecular structure of 3,5,5-trimethyl-2-cyclohexen-1-one
1-acetyl-2,4-dimethylcyclopentene
Molecular structure of 1-acetyl-2,4-dimethylcyclopentene
1-acetyl-2-methylcyclohexene
Molecular structure of 1-acetyl-2-methylcyclohexene
4-acetyl-1-methylcyclohexene
Molecular structure of 4-acetyl-1-methylcyclohexene
2-allylcyclohexanone
Molecular structure of 2-allylcyclohexanone
3-allyl-5-hexen-2-one
Molecular structure of 3-allyl-5-hexen-2-one
dicyclobutyl ketone
Molecular structure of dicyclobutyl ketone
6,6-dimethylbicyclo[3.1.1]heptan-2-one
Molecular structure of 6,6-dimethylbicyclo[3.1.1]heptan-2-one
(-)-7,7-dimethylbicyclo[2.2.1]heptan-2-one
Molecular structure of (-)-7,7-dimethylbicyclo[2.2.1]heptan-2-one
7,7-dimethylbicyclo[2.2.1]heptan-2-one
Molecular structure of 7,7-dimethylbicyclo[2.2.1]heptan-2-one
2,4-dimethyl-3-cyclohexenecarboxaldehyde
Molecular structure of 2,4-dimethyl-3-cyclohexenecarboxaldehyde
1-(3,3-dimethylcyclopenten-1-yl)ethanone
Molecular structure of 1-(3,3-dimethylcyclopenten-1-yl)ethanone
2,6-dimethyl-2,5-heptadien-4-one
Molecular structure of 2,6-dimethyl-2,5-heptadien-4-one
2-methyl-5-propan-2-ylidenecyclopentan-1-one
Molecular structure of 2-methyl-5-propan-2-ylidenecyclopentan-1-one
trans-2,cis-6-nonadienal
Molecular structure of trans-2,cis-6-nonadienal
1,8-nonadien-5-one
Molecular structure of 1,8-nonadien-5-one
(1R)-nopinone
Molecular structure of (1R)-nopinone
cis-octahydro-2H-inden-2-one
Molecular structure of cis-octahydro-2H-inden-2-one
trans-octahydro-2H-inden-2-one
Molecular structure of trans-octahydro-2H-inden-2-one
2-n-pentylfuran
Molecular structure of 2-n-pentylfuran
1-(1-propynyl)cyclohexanol
Molecular structure of 1-(1-propynyl)cyclohexanol
2,4,4-trimethyl-2-cyclohexenone
Molecular structure of 2,4,4-trimethyl-2-cyclohexenone
3,5,5-trimethylcyclohex-2-en-1-one
Molecular structure of 3,5,5-trimethylcyclohex-2-en-1-one
3,6,6-trimethyl-2-cyclohexen-1-one
Molecular structure of 3,6,6-trimethyl-2-cyclohexen-1-one
3,6,6-trimethyl-3-cyclohexen-1-one
Molecular structure of 3,6,6-trimethyl-3-cyclohexen-1-one
4,4,6-trimethyl-2-cyclohexen-1-one
Molecular structure of 4,4,6-trimethyl-2-cyclohexen-1-one