7-methyl-2-benzofuran-1(3H)-one


7-methyl-2-benzofuran-1(3H)-one
Formula:C9H8O2; 148.16 g/mol
InChiKey:QSLQEQHQWZHUEW-UHFFFAOYSA-N
SMILES:Cc1cccc2COC(=O)c12
Molecular structure of 7-methyl-2-benzofuran-1(3H)-one
Melting point:86 °C

Isomers

4-acetylbenzaldehyde
Molecular structure of 4-acetylbenzaldehyde
atropic acid
Molecular structure of atropic acid
bicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid
Molecular structure of bicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid
chroman-2-one
Molecular structure of chroman-2-one
4-chromanone
Molecular structure of 4-chromanone
2,3-dihydrobenzofuran-5-carboxaldehyde
Molecular structure of 2,3-dihydrobenzofuran-5-carboxaldehyde
5,6-dihydrocyclobuta[f][1,3]benzodioxole
Molecular structure of 5,6-dihydrocyclobuta[f][1,3]benzodioxole
4-hydroxy-1-indanone
Molecular structure of 4-hydroxy-1-indanone
5-hydroxy-1-indanone
Molecular structure of 5-hydroxy-1-indanone
6-hydroxy-1-indanone
Molecular structure of 6-hydroxy-1-indanone
7-hydroxy-1-indanone
Molecular structure of 7-hydroxy-1-indanone
isochroman-3-one
Molecular structure of isochroman-3-one
5-methoxybenzofuran
Molecular structure of 5-methoxybenzofuran
6-methoxybenzofuran
Molecular structure of 6-methoxybenzofuran
3-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 3-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
4-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 4-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
5-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 5-methoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
3-methyl-3H-2-benzofuran-1-one
Molecular structure of 3-methyl-3H-2-benzofuran-1-one
7-methyl-2-benzofuran-1(3H)-one
Molecular structure of 7-methyl-2-benzofuran-1(3H)-one
2-oxo-3-phenylpropanal
Molecular structure of 2-oxo-3-phenylpropanal
phenyl acrylate
Molecular structure of phenyl acrylate
1-phenyl-1,2-propanedione
Molecular structure of 1-phenyl-1,2-propanedione
(2E)-3-phenylprop-2-enoic acid
Molecular structure of (2E)-3-phenylprop-2-enoic acid
(2Z)-3-phenylprop-2-enoic acid
Molecular structure of (2Z)-3-phenylprop-2-enoic acid
vinyl benzoate
Molecular structure of vinyl benzoate
2-vinylbenzoic acid
Molecular structure of 2-vinylbenzoic acid
3-vinylbenzoic acid
Molecular structure of 3-vinylbenzoic acid
4-vinylbenzoic acid
Molecular structure of 4-vinylbenzoic acid