9-octadecanone


9-octadecanone
Links:🕷 ChemSpider
CAS:[18394-00-8]
Formula:C18H36O; 268.48 g/mol
InChiKey:RPUZRNKKZZATGV-UHFFFAOYSA-N
SMILES:CCCCCCCCCC(=O)CCCCCCCC
Molecular structure of 9-octadecanone

Isomers

1-ethenoxyhexadecane
Molecular structure of 1-ethenoxyhexadecane
hexadecyloxirane
Molecular structure of hexadecyloxirane
octadecanal
Molecular structure of octadecanal
2-octadecanone
Molecular structure of 2-octadecanone
3-octadecanone
Molecular structure of 3-octadecanone
9-octadecanone
Molecular structure of 9-octadecanone
(E)-octadec-9-enol
Molecular structure of (E)-octadec-9-enol
(Z)-octadec-9-en-1-ol
Molecular structure of (Z)-octadec-9-en-1-ol