D-leucine


(2R)-2-amino-4-methylpentanoic acid; D-leucine
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[328-38-1]
Formula:C6H13NO2; 131.17 g/mol
InChiKey:ROHFNLRQFUQHCH-RXMQYKEDSA-N
SMILES:CC(C)C[C@@H](N)C(O)=O
Molecular structure of D-leucine
Melting point:293 °C
Log10 partition octanol / water:-1.52

Isomers

DL-allo-isoleucine
Molecular structure of DL-allo-isoleucine
2-amino-3,3-dimethylbutanoic acid
Molecular structure of 2-amino-3,3-dimethylbutanoic acid
2-amino-2-ethylbutanoic acid
Molecular structure of 2-amino-2-ethylbutanoic acid
6-aminohexanoic acid
Molecular structure of 6-aminohexanoic acid
(2R,3S)-2-amino-3-methylpentanoic acid
Molecular structure of (2R,3S)-2-amino-3-methylpentanoic acid
(2S)-2-amino-3-methylpentanoic acid
Molecular structure of (2S)-2-amino-3-methylpentanoic acid
(2S,3R)-2-amino-3-methylpentanoic acid
Molecular structure of (2S,3R)-2-amino-3-methylpentanoic acid
N-butylglycine
Molecular structure of N-butylglycine
butyl N-methylcarbamate
Molecular structure of butyl N-methylcarbamate
N,N-diethyl-2-hydroxyacetamide
Molecular structure of N,N-diethyl-2-hydroxyacetamide
2,2-dimethyl-1,3-dioxolane-4-methanamine
Molecular structure of 2,2-dimethyl-1,3-dioxolane-4-methanamine
ethyl 2-aminobutanoate
Molecular structure of ethyl 2-aminobutanoate
ethyl 3-aminobutanoate
Molecular structure of ethyl 3-aminobutanoate
2-(ethylamino)butanoic acid
Molecular structure of 2-(ethylamino)butanoic acid
ethyl 2-dimethylaminoacetate
Molecular structure of ethyl 2-dimethylaminoacetate
ethylmethylcarbamic acid ethyl ester
Molecular structure of ethylmethylcarbamic acid ethyl ester
ethyl N-propylcarbamate
Molecular structure of ethyl N-propylcarbamate
hexyl nitrite
Molecular structure of hexyl nitrite
4-(2-hydroxyethyl)morpholine
Molecular structure of 4-(2-hydroxyethyl)morpholine
2-hydroxyhexanamide
Molecular structure of 2-hydroxyhexanamide
N-isobutylglycine
Molecular structure of N-isobutylglycine
dl-isoleucine
Molecular structure of dl-isoleucine
L-isoleucine
Molecular structure of L-isoleucine
D-leucine
Molecular structure of D-leucine
dl-leucine
Molecular structure of dl-leucine
L-leucine
Molecular structure of L-leucine
methyl 2-aminopentanoate
Molecular structure of methyl 2-aminopentanoate
methyl 3-aminopentanoate
Molecular structure of methyl 3-aminopentanoate
methyl 5-aminopentanoate
Molecular structure of methyl 5-aminopentanoate
2-methylaminopentanoic acid
Molecular structure of 2-methylaminopentanoic acid
2-methylbutan-2-yl carbamate
Molecular structure of 2-methylbutan-2-yl carbamate
methyl N-butylcarbamate
Molecular structure of methyl N-butylcarbamate
methyl N-(but-2-yl)carbamate
Molecular structure of methyl N-(but-2-yl)carbamate
3-methylbutyl carbamate
Molecular structure of 3-methylbutyl carbamate
methyl N,N-diethylcarbamate
Molecular structure of methyl N,N-diethylcarbamate
methyl 3-dimethylaminopropanoate
Molecular structure of methyl 3-dimethylaminopropanoate
methyl N-isobutylcarbamate
Molecular structure of methyl N-isobutylcarbamate
2-methyl-2-nitropentane
Molecular structure of 2-methyl-2-nitropentane
1-nitrohexane
Molecular structure of 1-nitrohexane
D-norleucine
Molecular structure of D-norleucine
dl-norleucine
Molecular structure of dl-norleucine
L-norleucine
Molecular structure of L-norleucine
pentyl carbamate
Molecular structure of pentyl carbamate
N-propylalanine
Molecular structure of N-propylalanine
2-trimethylammoniopropanoate
Molecular structure of 2-trimethylammoniopropanoate