N-(2,5-diethoxyphenyl)benzamide


2',5'-diethoxybenzanilide; N-(2,5-diethoxyphenyl)benzamide
CAS:[92-22-8]
Formula:C17H19NO3; 285.34 g/mol
InChiKey:OEZDYMAFWLGKFC-UHFFFAOYSA-N
SMILES:CCOc1ccc(OCC)c(NC(=O)c2ccccc2)c1
Molecular structure of N-(2,5-diethoxyphenyl)benzamide
Melting point:88 °C

Isomers

(R)-(+)-2-(carbobenzyloxyamino)-3-phenyl-1-propanol
Molecular structure of (R)-(+)-2-(carbobenzyloxyamino)-3-phenyl-1-propanol
coclaurine
Molecular structure of coclaurine
N-(2,5-diethoxyphenyl)benzamide
Molecular structure of N-(2,5-diethoxyphenyl)benzamide
3-[[(2,6-dimethylphenyl)amino]carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
Molecular structure of 3-[[(2,6-dimethylphenyl)amino]carbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
hydromorphone
Molecular structure of hydromorphone
1-(3'-hydroxypropyl)-4,6,8-trimethylfuro[2,3-h]quinolin-2(1H)-one
Molecular structure of 1-(3'-hydroxypropyl)-4,6,8-trimethylfuro[2,3-h]quinolin-2(1H)-one
morphine
Molecular structure of morphine
norcodeine
Molecular structure of norcodeine
piperine
Molecular structure of piperine
Z-L-phenylalaninol
Molecular structure of Z-L-phenylalaninol