coumarin


2H-1-benzopyran-2-one; chromen-2-one; 2H-chromen-2-one; coumarin
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis
CAS:[91-64-5]
Formula:C9H6O2; 146.15 g/mol
InChiKey:ZYGHJZDHTFUPRJ-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=CC(=O)O2
Molecular structure of coumarin
Odor:characteristic hay-like, main fragrance of woodruff
Density:0.935 g/mL
Molar volume:156.3 mL/mol
Melting point:70 °C
Boiling point:291 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:1.39
1g dissolves in:
1.14g pyridine;    2.02g trichloromethane;    10,000.00g water

Isomers

1-benzocyclobutenecarboxylic acid
Molecular structure of 1-benzocyclobutenecarboxylic acid
2-benzofurancarboxaldehyde
Molecular structure of 2-benzofurancarboxaldehyde
chromone
Molecular structure of chromone
coumarin
Molecular structure of coumarin
5-ethynyl-1,3-benzodioxole
Molecular structure of 5-ethynyl-1,3-benzodioxole
4-ethynylbenzoic acid
Molecular structure of 4-ethynylbenzoic acid
indan-1,2-dione
Molecular structure of indan-1,2-dione
1,3-indanedione
Molecular structure of 1,3-indanedione
isochromen-1-one
Molecular structure of isochromen-1-one
2-methylbicyclo[4.2.0]octa-1,3,5-triene-7,8-dione
Molecular structure of 2-methylbicyclo[4.2.0]octa-1,3,5-triene-7,8-dione
phenylpropynoic acid
Molecular structure of phenylpropynoic acid