epiquinidine


epiquinidine; 9-epi-quinidine; (R)-[(4S,5R,7R)-5-ethenyl-1-azabicyclo[2.2.2]octan-7-yl]-(6-methoxyquinolin-4-yl)methanol; (9R)-6'-methoxycinchonan-9-ol
Links:🕷 ChemSpider
CAS:[572-59-8]
Formula:C20H24N2O2; 324.42 g/mol
InChiKey:LOUPRKONTZGTKE-AFHBHXEDSA-N
SMILES:COc1ccc2nccc(C(O)C3C[C@H]4CCN3C[C@@H]4C=C)c2c1
Molecular structure of epiquinidine
Melting point:113 °C

Isomers

1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol
Molecular structure of 1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol
N,N-dibenzylethylenediamine diacetate
Molecular structure of N,N-dibenzylethylenediamine diacetate
epiquinidine
Molecular structure of epiquinidine
6'-methoxycinchonan-9-ol
Molecular structure of 6'-methoxycinchonan-9-ol
quinidine
Molecular structure of quinidine
quinine
Molecular structure of quinine
viquidil
Molecular structure of viquidil