isobutyl (R)-(+)-lactate


isobutyl (R)-(+)-lactate; 2-methylpropyl (2R)-2-hydroxypropanoate
CAS RN:[61597-96-4]
Formula:C7H14O3; 146.19 g/mol
InChiKey:WBPAQKQBUKYCJS-ZCFIWIBFSA-N
SMILES:CC(C)COC(=O)[C@@H](C)O
Molecular structure of isobutyl (R)-(+)-lactate
Density:0.971 g/mL
Molar volume:150.6 mL/mol

Isomers

3-(tert-butoxy)propionic acid
Molecular structure of 3-(tert-butoxy)propionic acid
butyl ethyl carbonate
Molecular structure of butyl ethyl carbonate
butyl (2S)-2-hydroxypropanoate
Molecular structure of butyl (2S)-2-hydroxypropanoate
butyl 3-hydroxypropanoate
Molecular structure of butyl 3-hydroxypropanoate
butyl lactate
Molecular structure of butyl lactate
butyl lactate
Molecular structure of butyl lactate
1,1-diethoxy-2-propanone
Molecular structure of 1,1-diethoxy-2-propanone
diethylene glycol monoallyl ether
Molecular structure of diethylene glycol monoallyl ether
diethyl vinyl orthoformate
Molecular structure of diethyl vinyl orthoformate
dipropyl carbonate
Molecular structure of dipropyl carbonate
2-ethoxyethyl propanoate
Molecular structure of 2-ethoxyethyl propanoate
1-ethoxypropan-2-yl acetate
Molecular structure of 1-ethoxypropan-2-yl acetate
5-ethyl-1,3-dioxane-5-methanol
Molecular structure of 5-ethyl-1,3-dioxane-5-methanol
ethyl 3-ethoxypropanoate
Molecular structure of ethyl 3-ethoxypropanoate
glycidaldehyde diethyl acetal
Molecular structure of glycidaldehyde diethyl acetal
2-hydroperoxy-2,4-dimethyl-3-pentanone
Molecular structure of 2-hydroperoxy-2,4-dimethyl-3-pentanone
(4R)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
Molecular structure of (4R)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
(4S)-(+)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
Molecular structure of (4S)-(+)-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
Molecular structure of 4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolane
isobutyl (R)-(+)-lactate
Molecular structure of isobutyl (R)-(+)-lactate
2-isopropoxyethyl acetate
Molecular structure of 2-isopropoxyethyl acetate
3-methoxybutyl acetate
Molecular structure of 3-methoxybutyl acetate
methyl 3-propoxypropanoate
Molecular structure of methyl 3-propoxypropanoate
2-methylpropyl 2-hydroxypropanoate
Molecular structure of 2-methylpropyl 2-hydroxypropanoate
2-propoxyethyl acetate
Molecular structure of 2-propoxyethyl acetate
propyl 3-methoxypropanoate
Molecular structure of propyl 3-methoxypropanoate
2-(tetrahydro-2H-pyran-2-yloxy)ethanol
Molecular structure of 2-(tetrahydro-2H-pyran-2-yloxy)ethanol