acetic acid menthyl ester; menthol acetic ester; menthol acetic ether; (-)-menthyl acetate; (1R)-(-)-menthyl acetate; l-menthyl acetate; (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl acetate |
Links: | 🌍 Wikipedia, 📖 PubMed |
CAS RN: | [2623-23-6] |
Formula: | C12H22O2; 198.31 g/mol
|
InChiKey: | XHXUANMFYXWVNG-ADEWGFFLSA-N |
SMILES: | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(C)=O |
![Molecular structure of l-menthyl acetate](mol2svg.php?id=5050&w=6&h=6) |
Use: | perfumes; synthetic caraway and peppermint type essences |
Density: | 0.920 g/mL |
Molar volume: | 215.5 mL/mol |
Refractive index: | 1.447 |
Molecular refractive power: | 57.58 mL/mol |
Dipole moment: | 1.83 D |
Boiling point: | 228 °C |
Log10 partition octanol / water: | 4.00 |