noxiptilin


noxiptilin
Links:📏 NIST
MeSH:Central Nervous System Agents; Psychotropic Drugs
CAS:[3362-45-6]
Formula:C19H22N2O; 294.40 g/mol
InChiKey:GPTURHKXTUDRPC-UHFFFAOYSA-N
SMILES:CN(C)CCON=C1c2ccccc2CCc3ccccc13
Molecular structure of noxiptilin

Isomers

cinchonidine
Molecular structure of cinchonidine
cinchonine
Molecular structure of cinchonine
cinchotoxine
Molecular structure of cinchotoxine
noxiptilin
Molecular structure of noxiptilin
1-pentyl-2-phenyl-1,2,3,4-tetrahydro-4-oxoquinazoline
Molecular structure of 1-pentyl-2-phenyl-1,2,3,4-tetrahydro-4-oxoquinazoline