phloretin


phloretin
CAS:[60-82-2]
Formula:C15H14O5; 274.27 g/mol
InChiKey:VGEREEWJJVICBM-UHFFFAOYSA-N
SMILES:Oc1ccc(CCC(=O)c2c(O)cc(O)cc2O)cc1
Molecular structure of phloretin
Melting point:260 °C

Isomers

bis(2-hydroxy-4-methoxyphenyl)methanone
Molecular structure of bis(2-hydroxy-4-methoxyphenyl)methanone
bis(2-methoxyphenyl) carbonate
Molecular structure of bis(2-methoxyphenyl) carbonate
bis(4-methoxyphenyl) carbonate
Molecular structure of bis(4-methoxyphenyl) carbonate
5,8-diethoxypsoralen
Molecular structure of 5,8-diethoxypsoralen
phloretin
Molecular structure of phloretin