viquidil


3-[(3R,4R)-3-ethenylpiperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-one; quinicin; quinotoxin; viquidil
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[84-55-9]
Formula:C20H24N2O2; 324.42 g/mol
InChiKey:DKRSEIPLAZTSFD-LSDHHAIUSA-N
SMILES:COc1ccc2nccc(C(=O)CC[C@@H]3CCNC[C@@H]3C=C)c2c1
Molecular structure of viquidil
Melting point:60 °C

Isomers

1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol
Molecular structure of 1-(tert-butylamino)-3-(fluoren-9-ylideneamino)oxypropan-2-ol
N,N-dibenzylethylenediamine diacetate
Molecular structure of N,N-dibenzylethylenediamine diacetate
epiquinidine
Molecular structure of epiquinidine
6'-methoxycinchonan-9-ol
Molecular structure of 6'-methoxycinchonan-9-ol
quinidine
Molecular structure of quinidine
quinine
Molecular structure of quinine
viquidil
Molecular structure of viquidil