(E)-3-furan-3-ylprop-2-enoic acid


trans-3-furanacrylic acid; (E)-3-furan-3-ylprop-2-enoic acid; 3-(3-furyl)acrylic acid; trans-3-(3-furyl)acrylic acid
CAS:[39244-10-5]
Formula:C7H6O3; 138.12 g/mol
InChiKey:JHAPZUDWRRBZHZ-OWOJBTEDSA-N
SMILES:OC(=O)/C=C/c1cocc1
Molecular structure of (E)-3-furan-3-ylprop-2-enoic acid
Melting point:153 °C

Isomers

1,3-benzodioxol-5-ol
Molecular structure of 1,3-benzodioxol-5-ol
1-cyclopentene-1,2-dicarboxylic anhydride
Molecular structure of 1-cyclopentene-1,2-dicarboxylic anhydride
2,3-dihydroxybenzaldehyde
Molecular structure of 2,3-dihydroxybenzaldehyde
2,4-dihydroxybenzaldehyde
Molecular structure of 2,4-dihydroxybenzaldehyde
2,5-dihydroxybenzaldehyde
Molecular structure of 2,5-dihydroxybenzaldehyde
3,4-dihydroxybenzaldehyde
Molecular structure of 3,4-dihydroxybenzaldehyde
3,5-dihydroxybenzaldehyde
Molecular structure of 3,5-dihydroxybenzaldehyde
(E)-3-furan-2-ylprop-2-enoic acid
Molecular structure of (E)-3-furan-2-ylprop-2-enoic acid
(E)-3-furan-3-ylprop-2-enoic acid
Molecular structure of (E)-3-furan-3-ylprop-2-enoic acid
2-hydroxybenzoic acid
Molecular structure of 2-hydroxybenzoic acid
3-hydroxybenzoic acid
Molecular structure of 3-hydroxybenzoic acid
4-hydroxybenzoic acid
Molecular structure of 4-hydroxybenzoic acid
perbenzoic acid
Molecular structure of perbenzoic acid