(3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate


3-hydroxy-2,2,4-trimethylpentyl isobutyrate; (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate; 3-hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate; 3-hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate; texanol ester alcohol; 2,2,4-trimethyl-1,3-pentanediol monoisobutyrate; 2,2,4-trimethyl-1,3-pentanediol 1-monoisobutyrate
Links:🕷 ChemSpider
CAS:[25265-77-4]
Formula:C12H24O3; 216.32 g/mol
InChiKey:DAFHKNAQFPVRKR-UHFFFAOYSA-N
SMILES:CC(C)C(O)C(C)(C)COC(=O)C(C)C
Molecular structure of (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate
Density:0.950 g/mL
Molar volume:227.7 mL/mol
Refractive index:1.442
Molecular refractive power:60.25 mL/mol
Melting point:-50 °C
Boiling point:244 °C
Critical temperature:392 °C
Critical volume:718.60 ml/mol
Evaporation rate (ether):6,051.0
Evaporation rate (butyl acetate):0.0
Hansen solubility parameter:δd: 7.4 (cal/mL)½   δp: 3.0 (cal/mL)½   δh: 4.8 (cal/mL)½

Isomers

tert-butyl 2-ethylhexaneperoxoate
Molecular structure of tert-butyl 2-ethylhexaneperoxoate
2,2-dibutyl-1,3-dioxolane-4-methanol
Molecular structure of 2,2-dibutyl-1,3-dioxolane-4-methanol
2,2-diisobutyl-1,3-dioxolane-4-methanol
Molecular structure of 2,2-diisobutyl-1,3-dioxolane-4-methanol
3-hydroxy-2,2-dimethylpropyl heptanoate
Molecular structure of 3-hydroxy-2,2-dimethylpropyl heptanoate
12-hydroxydodecanoic acid
Molecular structure of 12-hydroxydodecanoic acid
(3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate
Molecular structure of (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate
menthol acetate
Molecular structure of menthol acetate
2-methyl-2-n-heptyl-4-hydroxymethyl-1,3-dioxolane
Molecular structure of 2-methyl-2-n-heptyl-4-hydroxymethyl-1,3-dioxolane
2,4,6-tripropyl-1,3,5-trioxane
Molecular structure of 2,4,6-tripropyl-1,3,5-trioxane