1-butyl-3-methyl-1H-imidazol-3-ium trifluoromethanesulfonate


1-butyl-3-methylimidazolium trifluoromethanesulfonate; 1-n-butyl-3-methylimidazolium trifluoromethanesulfonate; 1-butyl-3-methyl-1H-imidazol-3-ium trifluoromethanesulfonate
CAS:[174899-66-2]
Formula:C9H15F3N2O3S; 288.29 g/mol
InChiKey:FRZPYEHDSAQGAS-UHFFFAOYSA-M
SMILES:CCCCn1cc[n+](C)c1.[O-][S](=O)(=O)C(F)(F)F
Molecular structure of 1-butyl-3-methyl-1H-imidazol-3-ium trifluoromethanesulfonate
Density:1.292 g/mL
Molar volume:223.1 mL/mol
Refractive index:1.439
Molecular refractive power:58.69 mL/mol
Melting point:-15 °C