1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide


1-butyl-3-methyl-1H-imidazol-3-ium bis[(trifluoromethyl)sulfonyl]azanide; 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
CAS:[174899-83-3]
Formula:C10H15F6N3O4S2; 419.37 g/mol
InChiKey:INDFXCHYORWHLQ-UHFFFAOYSA-N
SMILES:CCCCn1cc[n+](C)c1.FC(F)(F)[S](=O)(=O)[N-][S](=O)(=O)C(F)(F)F
Molecular structure of 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
Density:1.440 g/mL
Molar volume:291.2 mL/mol
Melting point:2 °C

Isomers

1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
Molecular structure of 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
1,2-dimethyl-3-propylimidazolium bis(trifluoromethylsulfonyl)imide
Molecular structure of 1,2-dimethyl-3-propylimidazolium bis(trifluoromethylsulfonyl)imide