1-ethyl-3-methyl-1H-imidazol-3-ium dicyanoazanide


1-ethyl-3-methylimidazolium dicyanamide; 1-ethyl-3-methyl-1H-imidazol-3-ium dicyanoazanide
CAS:[370865-89-7]
Formula:C8H11N5; 177.21 g/mol
InChiKey:MKHFCTXNDRMIDR-UHFFFAOYSA-N
SMILES:CCn1cc[n+](C)c1.N#C[N-]C#N
Molecular structure of 1-ethyl-3-methyl-1H-imidazol-3-ium dicyanoazanide
Melting point:-50 °C

Isomers

1-ethyl-3-methyl-1H-imidazol-3-ium dicyanoazanide
Molecular structure of 1-ethyl-3-methyl-1H-imidazol-3-ium dicyanoazanide
1-phenylbiguanide
Molecular structure of 1-phenylbiguanide
9-propyladenine
Molecular structure of 9-propyladenine