1-ethyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate


1-ethyl-3-methylimidazolium hexafluorophosphate; 1-ethyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate
CAS:[155371-19-0]
Formula:C6H11F6N2P; 256.13 g/mol
InChiKey:DPDAKOVGQUGTHH-UHFFFAOYSA-N
SMILES:CCn1cc[n+](C)c1.F[P-](F)(F)(F)(F)F
Molecular structure of 1-ethyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate
Melting point:60 °C