2,4-dinitrosobenzene-1,3-diol


2,4-dinitrosobenzene-1,3-diol; 2,4-dinitrosoresorcinol
Links:🕷 ChemSpider
CAS:[118-02-5]
Formula:C6H4N2O4; 168.11 g/mol
InChiKey:IBZJGOGLCABLDJ-UHFFFAOYSA-N
SMILES:Oc1ccc(N=O)c(O)c1N=O
Molecular structure of 2,4-dinitrosobenzene-1,3-diol
Melting point:168 °C

Isomers

1,2-dinitrobenzene
Molecular structure of 1,2-dinitrobenzene
1,3-dinitrobenzene
Molecular structure of 1,3-dinitrobenzene
1,4-dinitrobenzene
Molecular structure of 1,4-dinitrobenzene
2,4-dinitrosobenzene-1,3-diol
Molecular structure of 2,4-dinitrosobenzene-1,3-diol
6-nitropyridine-2-carboxylic acid
Molecular structure of 6-nitropyridine-2-carboxylic acid
2,3-pyrazinedicarboxylic acid
Molecular structure of 2,3-pyrazinedicarboxylic acid