2,5,7,7-tetramethyl-2-octanol


2,5,7,7-tetramethyl-2-octanol
Formula:C12H26O; 186.34 g/mol
InChiKey:UGLOKYGGSBZQTG-UHFFFAOYSA-N
SMILES:CC(CCC(C)(C)O)CC(C)(C)C
Molecular structure of 2,5,7,7-tetramethyl-2-octanol
Refractive index:1.436

Isomers

1-dodecanol
Molecular structure of 1-dodecanol
1-ethoxydecane
Molecular structure of 1-ethoxydecane
10-methyl-1-undecanol
Molecular structure of 10-methyl-1-undecanol
2,2,3,4,4,5-hexamethyl-3-hexanol
Molecular structure of 2,2,3,4,4,5-hexamethyl-3-hexanol
2,2,3,4,4-pentamethyl-3-heptanol
Molecular structure of 2,2,3,4,4-pentamethyl-3-heptanol
2,2,3,4-tetramethyl-4-ethyl-3-hexanol
Molecular structure of 2,2,3,4-tetramethyl-4-ethyl-3-hexanol
2,2,4,4,5,5-hexamethyl-3-hexanol
Molecular structure of 2,2,4,4,5,5-hexamethyl-3-hexanol
2,2,4,4-tetramethyl-3-isopropyl-3-pentanol
Molecular structure of 2,2,4,4-tetramethyl-3-isopropyl-3-pentanol
2,2,4-trimethyl-4-nonanol
Molecular structure of 2,2,4-trimethyl-4-nonanol
2,2,5-trimethyl-3-isopropyl-3-hexanol
Molecular structure of 2,2,5-trimethyl-3-isopropyl-3-hexanol
2,2-dimethyl-1-decanol
Molecular structure of 2,2-dimethyl-1-decanol
2,2-dimethyl-3-isopropyl-3-heptanol
Molecular structure of 2,2-dimethyl-3-isopropyl-3-heptanol
2,2-dimethyl-4,4-diethyl-3-hexanol
Molecular structure of 2,2-dimethyl-4,4-diethyl-3-hexanol
2,2-dimethyl-4-propyl-4-heptanol
Molecular structure of 2,2-dimethyl-4-propyl-4-heptanol
2,4,4-trimethyl-2-tert-butyl-1-pentanol
Molecular structure of 2,4,4-trimethyl-2-tert-butyl-1-pentanol
2,4-dimethyl-4-decanol
Molecular structure of 2,4-dimethyl-4-decanol
2,5,5-trimethyl-3-isopropyl-3-hexanol
Molecular structure of 2,5,5-trimethyl-3-isopropyl-3-hexanol
2,5,7,7-tetramethyl-2-octanol
Molecular structure of 2,5,7,7-tetramethyl-2-octanol
2,6-dimethyl-3-isopropyl-3-heptanol
Molecular structure of 2,6-dimethyl-3-isopropyl-3-heptanol
2,6-dimethyl-4-isopropyl-4-heptanol
Molecular structure of 2,6-dimethyl-4-isopropyl-4-heptanol
2-butyl-1-octanol
Molecular structure of 2-butyl-1-octanol
2-dodecanol
Molecular structure of 2-dodecanol
2-methyl-3-isopropyl-3-octanol
Molecular structure of 2-methyl-3-isopropyl-3-octanol
2-methyl-4-ethyl-3-isopropyl-3-hexanol
Molecular structure of 2-methyl-4-ethyl-3-isopropyl-3-hexanol
2-methyl-4-undecanol
Molecular structure of 2-methyl-4-undecanol
2-methyl-5-undecanol
Molecular structure of 2-methyl-5-undecanol
3,3,4,5,5-pentamethyl-4-heptanol
Molecular structure of 3,3,4,5,5-pentamethyl-4-heptanol
3,3-dimethyl-4-decanol
Molecular structure of 3,3-dimethyl-4-decanol
3,7,7-trimethyl-3-nonanol
Molecular structure of 3,7,7-trimethyl-3-nonanol
3-butyl-3-methyl-2-heptanol
Molecular structure of 3-butyl-3-methyl-2-heptanol
3-dodecanol
Molecular structure of 3-dodecanol
3-methyl-1-undecanol
Molecular structure of 3-methyl-1-undecanol
3-methyl-3-undecanol
Molecular structure of 3-methyl-3-undecanol
4-butyl-1-octanol
Molecular structure of 4-butyl-1-octanol
4-dodecanol
Molecular structure of 4-dodecanol
4-propyl-4-nonanol
Molecular structure of 4-propyl-4-nonanol
5,5-dimethyl-4-tert-butyl-1-hexanol
Molecular structure of 5,5-dimethyl-4-tert-butyl-1-hexanol
5-dodecanol
Molecular structure of 5-dodecanol
5-ethyl-5-decanol
Molecular structure of 5-ethyl-5-decanol
5-isopropyl-5-nonanol
Molecular structure of 5-isopropyl-5-nonanol
5-methyl-2-(3-methylbutyl)-1-hexanol
Molecular structure of 5-methyl-2-(3-methylbutyl)-1-hexanol
5-methyl-5-undecanol
Molecular structure of 5-methyl-5-undecanol
5-propyl-5-nonanol
Molecular structure of 5-propyl-5-nonanol
6,6-dimethyl-5-decanol
Molecular structure of 6,6-dimethyl-5-decanol
6-dodecanol
Molecular structure of 6-dodecanol
6-methyl-6-undecanol
Molecular structure of 6-methyl-6-undecanol
9-methyl-1-undecanol
Molecular structure of 9-methyl-1-undecanol
dihexyl ether
Molecular structure of dihexyl ether