2-benzoylbenzoic acid


o-benzoylbenzoic acid; 2-benzoylbenzoic acid
Links:⚗️ ChemSynthesis
CAS:[85-52-9]
Formula:C14H10O3; 226.23 g/mol
InChiKey:FGTYTUFKXYPTML-UHFFFAOYSA-N
SMILES:OC(=O)c1ccccc1C(=O)c2ccccc2
Molecular structure of 2-benzoylbenzoic acid
Melting point:128 °C
Boiling point:257 °C

Isomers

anthrarobin
Molecular structure of anthrarobin
benzoic anhydride
Molecular structure of benzoic anhydride
2-benzoylbenzoic acid
Molecular structure of 2-benzoylbenzoic acid
3-benzoylbenzoic acid
Molecular structure of 3-benzoylbenzoic acid
4-benzoylbenzoic acid
Molecular structure of 4-benzoylbenzoic acid
1,8-dihydroxyanthracen-9(10~H)-one
Molecular structure of 1,8-dihydroxyanthracen-9(10H)-one
flurenol
Molecular structure of flurenol
4-(4-formylphenoxy)benzaldehyde
Molecular structure of 4-(4-formylphenoxy)benzaldehyde
3-(4-formylphenyl)benzoic acid
Molecular structure of 3-(4-formylphenyl)benzoic acid
4,6,7,9-tetrahydrocyclobuta[6,7]naphtho[2,3-c]furan-1,3-dione
Molecular structure of 4,6,7,9-tetrahydrocyclobuta[6,7]naphtho[2,3-c]furan-1,3-dione
1,8,9-trihydroxyanthracene
Molecular structure of 1,8,9-trihydroxyanthracene
xanthene-9-carboxylic acid
Molecular structure of xanthene-9-carboxylic acid