2-cyanophenoxyacetic acid


o-cyanophenoxyacetic acid; 2-cyanophenoxyacetic acid
Formula:C9H7NO3; 177.16 g/mol
InChiKey:FNJPHLBTJIHHPG-UHFFFAOYSA-N
SMILES:OC(=O)COc1ccccc1C#N
Molecular structure of 2-cyanophenoxyacetic acid

Isomers

6-acetyl-2(3~H)-benzoxazolone
Molecular structure of 6-acetyl-2(3H)-benzoxazolone
2-cyanophenoxyacetic acid
Molecular structure of 2-cyanophenoxyacetic acid
3-cyanophenoxyacetic acid
Molecular structure of 3-cyanophenoxyacetic acid
4-cyanophenoxyacetic acid
Molecular structure of 4-cyanophenoxyacetic acid
5-hydroxyindole-2-carboxylic acid
Molecular structure of 5-hydroxyindole-2-carboxylic acid
2-(hydroxymethyl)isoindole-1,3-dione
Molecular structure of 2-(hydroxymethyl)isoindole-1,3-dione
6-isocyanato-1,4-benzodioxane
Molecular structure of 6-isocyanato-1,4-benzodioxane
2-(methoxycarbonyl)phenyl isocyanate
Molecular structure of 2-(methoxycarbonyl)phenyl isocyanate
3-(methoxycarbonyl)phenyl isocyanate
Molecular structure of 3-(methoxycarbonyl)phenyl isocyanate
5-methoxy-1H-indole-2,3-dione
Molecular structure of 5-methoxy-1H-indole-2,3-dione
N-methylisatoic anhydride
Molecular structure of N-methylisatoic anhydride
methyl 4-isocyanatobenzoate
Molecular structure of methyl 4-isocyanatobenzoate
trans-2-nitrocinnamaldehyde
Molecular structure of trans-2-nitrocinnamaldehyde
(E)-3-(4-nitrophenyl)prop-2-enal
Molecular structure of (E)-3-(4-nitrophenyl)prop-2-enal