2-formylphenoxyacetic acid


2-formylphenoxyacetic acid
CAS:[6280-80-4]
Formula:C9H8O4; 180.16 g/mol
InChiKey:ANWMNLAAFDCKMT-UHFFFAOYSA-N
SMILES:OC(=O)COc1ccccc1C=O
Molecular structure of 2-formylphenoxyacetic acid
Melting point:133 °C

Isomers

2-acetoxybenzoic acid
Molecular structure of 2-acetoxybenzoic acid
3-acetoxybenzoic acid
Molecular structure of 3-acetoxybenzoic acid
4-acetoxybenzoic acid
Molecular structure of 4-acetoxybenzoic acid
acetyl benzoyl peroxide
Molecular structure of acetyl benzoyl peroxide
5-acetyl-2-hydroxybenzoic acid
Molecular structure of 5-acetyl-2-hydroxybenzoic acid
1,4-benzodioxan-5-carboxylic acid
Molecular structure of 1,4-benzodioxan-5-carboxylic acid
(R)-1,4-benzodioxane-2-carboxylic acid
Molecular structure of (R)-1,4-benzodioxane-2-carboxylic acid
(S)-1,4-benzodioxane-2-carboxylic acid
Molecular structure of (S)-1,4-benzodioxane-2-carboxylic acid
1,4-benzodioxane-2-carboxylic acid
Molecular structure of 1,4-benzodioxane-2-carboxylic acid
1,4-benzodioxane-6-carboxylic acid
Molecular structure of 1,4-benzodioxane-6-carboxylic acid
benzoyloxyacetic acid
Molecular structure of benzoyloxyacetic acid
caffeic acid
Molecular structure of caffeic acid
3-(carboxymethyl)benzoic acid
Molecular structure of 3-(carboxymethyl)benzoic acid
2,4-dihydroxycinnamic acid
Molecular structure of 2,4-dihydroxycinnamic acid
2-formylphenoxyacetic acid
Molecular structure of 2-formylphenoxyacetic acid
4-formylphenoxyacetic acid
Molecular structure of 4-formylphenoxyacetic acid
homophthalic acid
Molecular structure of homophthalic acid
3-hydroxy-5-methoxy-2-benzofuran-1(3H)-one
Molecular structure of 3-hydroxy-5-methoxy-2-benzofuran-1(3H)-one
4-hydroxyphenylpyruvic acid
Molecular structure of 4-hydroxyphenylpyruvic acid
6-methoxy-1,3-benzodioxole-5-carbaldehyde
Molecular structure of 6-methoxy-1,3-benzodioxole-5-carbaldehyde
2-methoxycarbonylbenzoic acid
Molecular structure of 2-methoxycarbonylbenzoic acid
3-methoxycarbonylbenzoic acid
Molecular structure of 3-methoxycarbonylbenzoic acid
4-methoxycarbonylbenzoic acid
Molecular structure of 4-methoxycarbonylbenzoic acid
methyl 1,3-benzodioxole-5-carboxylate
Molecular structure of methyl 1,3-benzodioxole-5-carboxylate
3,4-methylendioxyphenylacetic acid
Molecular structure of 3,4-methylendioxyphenylacetic acid
methyl 3-formyl-4-hydroxybenzoate
Molecular structure of methyl 3-formyl-4-hydroxybenzoate
5-methylisophthalic acid
Molecular structure of 5-methylisophthalic acid
4-methylphthalic acid
Molecular structure of 4-methylphthalic acid
4-methyl-3α,4,7,7α-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione
Molecular structure of 4-methyl-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione
2-phenylpropanedioic acid
Molecular structure of 2-phenylpropanedioic acid