2-phenylbenzoic acid


[1,1'-biphenyl]-2-carboxylic acid; 2-biphenylcarboxylic acid; biphenyl-2-carboxylic acid; o-phenylbenzoic acid; 2-phenylbenzoic acid
Links:📖 PubMed
CAS:[947-84-2]
Formula:C13H10O2; 198.22 g/mol
InChiKey:ILYSAKHOYBPSPC-UHFFFAOYSA-N
SMILES:OC(=O)c1ccccc1c2ccccc2
Molecular structure of 2-phenylbenzoic acid
Melting point:115 °C
Boiling point:344 °C
Log10 partition octanol / water:2.89

Isomers

acenaphthene-5-carboxylic acid
Molecular structure of acenaphthene-5-carboxylic acid
biphenyl-3-carboxylic acid
Molecular structure of biphenyl-3-carboxylic acid
biphenyl-4-carboxylic acid
Molecular structure of biphenyl-4-carboxylic acid
(Z)-3-furan-2-yl-2-phenylprop-2-enal
Molecular structure of (Z)-3-furan-2-yl-2-phenylprop-2-enal
(E)-1-furan-2-yl-3-phenylprop-2-en-1-one
Molecular structure of (E)-1-furan-2-yl-3-phenylprop-2-en-1-one
(E)-3-furan-2-yl-1-phenylprop-2-en-1-one
Molecular structure of (E)-3-furan-2-yl-1-phenylprop-2-en-1-one
9-hydroperoxy-9H-fluorene
Molecular structure of 9-hydroperoxy-9H-fluorene
2-hydroxybenzophenone
Molecular structure of 2-hydroxybenzophenone
4-hydroxybenzophenone
Molecular structure of 4-hydroxybenzophenone
(3-hydroxyphenyl)-phenylmethanone
Molecular structure of (3-hydroxyphenyl)-phenylmethanone
3-(1-naphthyl)acrylic acid
Molecular structure of 3-(1-naphthyl)acrylic acid
3-phenoxybenzaldehyde
Molecular structure of 3-phenoxybenzaldehyde
4-phenoxybenzaldehyde
Molecular structure of 4-phenoxybenzaldehyde
phenyl benzoate
Molecular structure of phenyl benzoate
2-phenylbenzoic acid
Molecular structure of 2-phenylbenzoic acid
9H-xanthen-9-ol
Molecular structure of 9H-xanthen-9-ol