3-methylbutyl nonanoate


isoamyl nonanoate; 3-methylbutyl nonanoate
CAS RN:[7779-70-6]
Formula:C14H28O2; 228.38 g/mol
InChiKey:SHGMLOSSRPFLKG-UHFFFAOYSA-N
SMILES:CCCCCCCCC(=O)OCCC(C)C
Molecular structure of 3-methylbutyl nonanoate
Density:0.860 g/mL
Molar volume:265.6 mL/mol
Boiling point:260 °C

Isomers

trans-1-[(2-tert-butylcyclohexyl)oxy]butan-2-ol
Molecular structure of trans-1-[(2-tert-butylcyclohexyl)oxy]butan-2-ol
butyl decanoate
Molecular structure of butyl decanoate
decyl butanoate
Molecular structure of decyl butanoate
1,1-dimethoxycyclododecane
Molecular structure of 1,1-dimethoxycyclododecane
dodecyl acetate
Molecular structure of dodecyl acetate
ethyl dodecanoate
Molecular structure of ethyl dodecanoate
heptyl heptanoate
Molecular structure of heptyl heptanoate
hexyl octanoate
Molecular structure of hexyl octanoate
3-methylbutyl nonanoate
Molecular structure of 3-methylbutyl nonanoate
methyl tridecanoate
Molecular structure of methyl tridecanoate
octyl hexanoate
Molecular structure of octyl hexanoate
pentyl nonanoate
Molecular structure of pentyl nonanoate
tetradecanoic acid
Molecular structure of tetradecanoic acid