3-methylphenoxyacetic acid


m-methylphenoxyacetic acid; 2-(3-methylphenoxy)acetic acid; 3-methylphenoxyacetic acid
CAS:[1643-15-8]
Formula:C9H10O3; 166.18 g/mol
InChiKey:VZECTCSEONQIPP-UHFFFAOYSA-N
SMILES:Cc1cccc(OCC(O)=O)c1
Molecular structure of 3-methylphenoxyacetic acid
Melting point:104 °C
Log10 partition octanol / water:1.78

Isomers

4-acetoxybenzyl alcohol
Molecular structure of 4-acetoxybenzyl alcohol
apocynin
Molecular structure of apocynin
benzyloxyacetic acid
Molecular structure of benzyloxyacetic acid
(2R,3S)-bicyclo[2,2,1]heptane-2,3-dicarboxylic anhydride
Molecular structure of (2R,3S)-bicyclo[2,2,1]heptane-2,3-dicarboxylic anhydride
(2S,3R)-bicyclo[2,2,1]heptane-2,3-dicarboxylic anhydride
Molecular structure of (2S,3R)-bicyclo[2,2,1]heptane-2,3-dicarboxylic anhydride
2',4'-dihydroxy-3'-methylacetophenone
Molecular structure of 2',4'-dihydroxy-3'-methylacetophenone
1-(2,4-dihydroxyphenyl)-1-propanone
Molecular structure of 1-(2,4-dihydroxyphenyl)-1-propanone
1-(2,5-dihydroxyphenyl)-1-propanone
Molecular structure of 1-(2,5-dihydroxyphenyl)-1-propanone
1-(3,4-dihydroxyphenyl)propan-1-one
Molecular structure of 1-(3,4-dihydroxyphenyl)propan-1-one
2,3-dimethoxybenzaldehyde
Molecular structure of 2,3-dimethoxybenzaldehyde
2,4-dimethoxybenzaldehyde
Molecular structure of 2,4-dimethoxybenzaldehyde
2,5-dimethoxybenzaldehyde
Molecular structure of 2,5-dimethoxybenzaldehyde
2,6-dimethoxybenzaldehyde
Molecular structure of 2,6-dimethoxybenzaldehyde
3,4-dimethoxybenzaldehyde
Molecular structure of 3,4-dimethoxybenzaldehyde
3,5-dimethoxybenzaldehyde
Molecular structure of 3,5-dimethoxybenzaldehyde
2-ethoxybenzoic acid
Molecular structure of 2-ethoxybenzoic acid
3-ethoxybenzoic acid
Molecular structure of 3-ethoxybenzoic acid
4-ethoxybenzoic acid
Molecular structure of 4-ethoxybenzoic acid
3-ethoxy-2-hydroxybenzaldehyde
Molecular structure of 3-ethoxy-2-hydroxybenzaldehyde
3-ethoxy-4-hydroxybenzaldehyde
Molecular structure of 3-ethoxy-4-hydroxybenzaldehyde
5-ethoxy-2-hydroxybenzaldehyde
Molecular structure of 5-ethoxy-2-hydroxybenzaldehyde
ethyl trans-3-furan-2-ylprop-2-enoate
Molecular structure of ethyl trans-3-furan-2-ylprop-2-enoate
ethyl 3-hydroxybenzoate
Molecular structure of ethyl 3-hydroxybenzoate
ethyl 4-hydroxybenzoate
Molecular structure of ethyl 4-hydroxybenzoate
ethyl salicylate
Molecular structure of ethyl salicylate
4-hydroxy-3,5-dimethylbenzoic acid
Molecular structure of 4-hydroxy-3,5-dimethylbenzoic acid
2-hydroxyethyl benzoate
Molecular structure of 2-hydroxyethyl benzoate
2'-hydroxy-4'-methoxyacetophenone
Molecular structure of 2'-hydroxy-4'-methoxyacetophenone
2'-hydroxy-5'-methoxyacetophenone
Molecular structure of 2'-hydroxy-5'-methoxyacetophenone
2'-hydroxy-6'-methoxyacetophenone
Molecular structure of 2'-hydroxy-6'-methoxyacetophenone
4-hydroxy-3-methoxy-2-methylbenzaldehyde
Molecular structure of 4-hydroxy-3-methoxy-2-methylbenzaldehyde
4-hydroxy-5-methoxy-2-methylbenzaldehyde
Molecular structure of 4-hydroxy-5-methoxy-2-methylbenzaldehyde
1-(3-hydroxy-4-methoxyphenyl)ethanone
Molecular structure of 1-(3-hydroxy-4-methoxyphenyl)ethanone
2-hydroxy-1-(4-methoxyphenyl)ethanone
Molecular structure of 2-hydroxy-1-(4-methoxyphenyl)ethanone
2-hydroxymethyl-1,4-benzodioxane
Molecular structure of 2-hydroxymethyl-1,4-benzodioxane
4-(hydroxymethyl)phenylacetic acid
Molecular structure of 4-(hydroxymethyl)phenylacetic acid
4-hydroxy-3-methylphenylacetic acid
Molecular structure of 4-hydroxy-3-methylphenylacetic acid
2-hydroxy-2-phenylpropanoic acid
Molecular structure of 2-hydroxy-2-phenylpropanoic acid
2-hydroxy-3-phenylpropanoic acid
Molecular structure of 2-hydroxy-3-phenylpropanoic acid
2-(4-hydroxyphenyl)propanoic acid
Molecular structure of 2-(4-hydroxyphenyl)propanoic acid
(-)-3-hydroxy-2-phenylpropanoic acid
Molecular structure of (-)-3-hydroxy-2-phenylpropanoic acid
3-hydroxy-2-phenylpropanoic acid
Molecular structure of 3-hydroxy-2-phenylpropanoic acid
3-hydroxy-3-phenylpropanoic acid
Molecular structure of 3-hydroxy-3-phenylpropanoic acid
3-(2-hydroxyphenyl)propionic acid
Molecular structure of 3-(2-hydroxyphenyl)propionic acid
3-(3-hydroxyphenyl)propionic acid
Molecular structure of 3-(3-hydroxyphenyl)propionic acid
3-(4-hydroxyphenyl)propionic acid
Molecular structure of 3-(4-hydroxyphenyl)propionic acid
4-methoxybenzyl formate
Molecular structure of 4-methoxybenzyl formate
2-methoxy-4-methylbenzoic acid
Molecular structure of 2-methoxy-4-methylbenzoic acid
2-methoxy-5-methylbenzoic acid
Molecular structure of 2-methoxy-5-methylbenzoic acid
3-methoxy-4-methylbenzoic acid
Molecular structure of 3-methoxy-4-methylbenzoic acid
4-methoxy-2-methylbenzoic acid
Molecular structure of 4-methoxy-2-methylbenzoic acid
5-methoxy-2-methylbenzoic acid
Molecular structure of 5-methoxy-2-methylbenzoic acid
2-methoxyphenyl acetate
Molecular structure of 2-methoxyphenyl acetate
3-methoxyphenyl acetate
Molecular structure of 3-methoxyphenyl acetate
4-methoxyphenyl acetate
Molecular structure of 4-methoxyphenyl acetate
2-methoxyphenylacetic acid
Molecular structure of 2-methoxyphenylacetic acid
(2R)-2-methoxy-2-phenylacetic acid
Molecular structure of (2R)-2-methoxy-2-phenylacetic acid
(2S)-2-methoxy-2-phenylacetic acid
Molecular structure of (2S)-2-methoxy-2-phenylacetic acid
2-methoxy-2-phenylacetic acid
Molecular structure of 2-methoxy-2-phenylacetic acid
3-methoxyphenylacetic acid
Molecular structure of 3-methoxyphenylacetic acid
4-methoxyphenylacetic acid
Molecular structure of 4-methoxyphenylacetic acid
methyl 2-hydroxy-3-methylbenzoate
Molecular structure of methyl 2-hydroxy-3-methylbenzoate
methyl 2-hydroxy-4-methylbenzoate
Molecular structure of methyl 2-hydroxy-4-methylbenzoate
methyl 2-hydroxy-5-methylbenzoate
Molecular structure of methyl 2-hydroxy-5-methylbenzoate
methyl 4-(hydroxymethyl)benzoate
Molecular structure of methyl 4-(hydroxymethyl)benzoate
methyl (2R)-2-hydroxy-2-phenylacetate
Molecular structure of methyl (2R)-2-hydroxy-2-phenylacetate
methyl (2S)-2-hydroxy-2-phenylacetate
Molecular structure of methyl (2S)-2-hydroxy-2-phenylacetate
methyl 2-hydroxy-2-phenylacetate
Molecular structure of methyl 2-hydroxy-2-phenylacetate
methyl 4-hydroxyphenylacetate
Molecular structure of methyl 4-hydroxyphenylacetate
methyl 2-methoxybenzoate
Molecular structure of methyl 2-methoxybenzoate
methyl 3-methoxybenzoate
Molecular structure of methyl 3-methoxybenzoate
methyl 4-methoxybenzoate
Molecular structure of methyl 4-methoxybenzoate
methyl phenoxyacetate
Molecular structure of methyl phenoxyacetate
2-methylphenoxyacetic acid
Molecular structure of 2-methylphenoxyacetic acid
3-methylphenoxyacetic acid
Molecular structure of 3-methylphenoxyacetic acid
4-methylphenoxyacetic acid
Molecular structure of 4-methylphenoxyacetic acid
4-methyl-3α,4,7,7α-tetrahydro-2-benzofuran-1,3-dione
Molecular structure of 4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione
5-methyl-3α,4,7,7α-tetrahydro-2-benzofuran-1,3-dione
Molecular structure of 5-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione
3-phenoxypropanoic acid
Molecular structure of 3-phenoxypropanoic acid
2-phenoxypropionic acid
Molecular structure of 2-phenoxypropionic acid
3-phenyl-3-hydroxypropanoic acid
Molecular structure of 3-phenyl-3-hydroxypropanoic acid
L-(-)-3-phenyllactic acid
Molecular structure of L-(-)-3-phenyllactic acid