3-phenoxyphenol


3-phenoxyphenol
CAS:[713-68-8]
Formula:C12H10O2; 186.21 g/mol
InChiKey:HBUCPZGYBSEEHF-UHFFFAOYSA-N
SMILES:Oc1cccc(Oc2ccccc2)c1
Molecular structure of 3-phenoxyphenol
Density:1.159 g/mL
Molar volume:160.7 mL/mol
Refractive index:1.601
Molecular refractive power:55.04 mL/mol
Melting point:42 °C

Isomers

1-acetyl-2-naphthol
Molecular structure of 1-acetyl-2-naphthol
1-acetyl-4-naphthol
Molecular structure of 1-acetyl-4-naphthol
2-acetyl-1-naphthol
Molecular structure of 2-acetyl-1-naphthol
2,2'-dihydroxybiphenyl
Molecular structure of 2,2'-dihydroxybiphenyl
2,3-dihydroxybiphenyl
Molecular structure of 2,3-dihydroxybiphenyl
3,3'-dihydroxybiphenyl
Molecular structure of 3,3'-dihydroxybiphenyl
4,4'-dihydroxybiphenyl
Molecular structure of 4,4'-dihydroxybiphenyl
2,7-dimethylnaphthalene-1,4-dione
Molecular structure of 2,7-dimethylnaphthalene-1,4-dione
2,3-dimethyl-1,4-naphthoquinone
Molecular structure of 2,3-dimethyl-1,4-naphthoquinone
6,7-dimethyl-1,4-naphthoquinone
Molecular structure of 6,7-dimethyl-1,4-naphthoquinone
2,7-dimethyltricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,10-dione
Molecular structure of 2,7-dimethyltricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,10-dione
2,7-dimethyltricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,9-dione
Molecular structure of 2,7-dimethyltricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,9-dione
6,7-dimethyltricyclo[6.2.0.02,5]deca-1,5,7-triene-3,9-dione
Molecular structure of 6,7-dimethyltricyclo[6.2.0.02,5]deca-1,5,7-triene-3,9-dione
6,7-dimethyltricyclo[6.2.0.02,5]deca-1,5,7-triene-4,9-dione
Molecular structure of 6,7-dimethyltricyclo[6.2.0.02,5]deca-1,5,7-triene-4,9-dione
2-(3-hydroxyphenyl)phenol
Molecular structure of 2-(3-hydroxyphenyl)phenol
2-methoxy-1-naphthaldehyde
Molecular structure of 2-methoxy-1-naphthaldehyde
4-methoxy-1-naphthaldehyde
Molecular structure of 4-methoxy-1-naphthaldehyde
6-methoxy-2-naphthaldehyde
Molecular structure of 6-methoxy-2-naphthaldehyde
methyl 1-naphthoate
Molecular structure of methyl 1-naphthoate
methyl 2-naphthoate
Molecular structure of methyl 2-naphthoate
2-methyl-1-naphthoic acid
Molecular structure of 2-methyl-1-naphthoic acid
4-methyl-1-naphthoic acid
Molecular structure of 4-methyl-1-naphthoic acid
2-methyl-6-phenyl-4H-pyran-4-one
Molecular structure of 2-methyl-6-phenyl-4H-pyran-4-one
2-naphthalenacetic acid
Molecular structure of 2-naphthalenacetic acid
1-naphthaleneacetic acid
Molecular structure of 1-naphthaleneacetic acid
1-naphthyl acetate
Molecular structure of 1-naphthyl acetate
2-naphthyl acetate
Molecular structure of 2-naphthyl acetate
2-(phenoxy)phenol
Molecular structure of 2-(phenoxy)phenol
3-phenoxyphenol
Molecular structure of 3-phenoxyphenol
4-phenoxyphenol
Molecular structure of 4-phenoxyphenol
4-phenylcatechol
Molecular structure of 4-phenylcatechol
2-phenylhydroquinone
Molecular structure of 2-phenylhydroquinone