3-phenylphenol


m-hydroxybiphenyl; m-phenylphenol; 3-phenylphenol
Links:📏 NIST, 📖 PubMed
CAS:[580-51-8]
Formula:C12H10O; 170.21 g/mol
InChiKey:UBXYXCRCOKCZIT-UHFFFAOYSA-N
SMILES:Oc1cccc(c1)c2ccccc2
Molecular structure of 3-phenylphenol
Melting point:78 °C
Log10 partition octanol / water:3.75

Isomers

1-acetylazulene
Molecular structure of 1-acetylazulene
1-acetylnaphthalene
Molecular structure of 1-acetylnaphthalene
2-acetylnaphthalene
Molecular structure of 2-acetylnaphthalene
1,2-dihydroacenaphthylen-1-ol
Molecular structure of 1,2-dihydroacenaphthylen-1-ol
diphenyl ether
Molecular structure of diphenyl ether
1-formyl-2-methylnaphthalene
Molecular structure of 1-formyl-2-methylnaphthalene
8-methylbenzo[7]annulen-7-one
Molecular structure of 8-methylbenzo[7]annulen-7-one
4-methyl-1-naphthaldehyde
Molecular structure of 4-methyl-1-naphthaldehyde
2-phenylphenol
Molecular structure of 2-phenylphenol
3-phenylphenol
Molecular structure of 3-phenylphenol
4-phenylphenol
Molecular structure of 4-phenylphenol