4-acetylbenzoic acid


p-acetylbenzoic acid; 4-acetylbenzoic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[586-89-0]
Formula:C9H8O3; 164.16 g/mol
InChiKey:QBHDSQZASIBAAI-UHFFFAOYSA-N
SMILES:CC(=O)c1ccc(cc1)C(O)=O
Molecular structure of 4-acetylbenzoic acid
Melting point:210 °C
Log10 partition octanol / water:1.61

Isomers

2-acetoxybenzaldehyde
Molecular structure of 2-acetoxybenzaldehyde
3-acetoxybenzaldehyde
Molecular structure of 3-acetoxybenzaldehyde
4-acetoxybenzaldehyde
Molecular structure of 4-acetoxybenzaldehyde
2-acetylbenzoic acid
Molecular structure of 2-acetylbenzoic acid
3-acetylbenzoic acid
Molecular structure of 3-acetylbenzoic acid
4-acetylbenzoic acid
Molecular structure of 4-acetylbenzoic acid
1,4-benzodioxane-6-carboxaldehyde
Molecular structure of 1,4-benzodioxane-6-carboxaldehyde
1,3-benzodioxole-5-acetaldehyde
Molecular structure of 1,3-benzodioxole-5-acetaldehyde
carbic anhydride
Molecular structure of carbic anhydride
2,3-dihydro-5H-1,4-benzodioxepin-5-one
Molecular structure of 2,3-dihydro-5H-1,4-benzodioxepin-5-one
2-hydroxy-5-methyl-1,3-benzenedicarboxaldehyde
Molecular structure of 2-hydroxy-5-methyl-1,3-benzenedicarboxaldehyde
3-hydroxy-7-methyl-2-benzofuran-1(3H)-one
Molecular structure of 3-hydroxy-7-methyl-2-benzofuran-1(3H)-one
3-hydroxy-3-methyl-1(3~H)-isobenzofuranone
Molecular structure of 3-hydroxy-3-methyl-1(3H)-isobenzofuranone
(E)-3-(2-hydroxyphenyl)prop-2-enoic acid
Molecular structure of (E)-3-(2-hydroxyphenyl)prop-2-enoic acid
(E)-3-(3-hydroxyphenyl)prop-2-enoic acid
Molecular structure of (E)-3-(3-hydroxyphenyl)prop-2-enoic acid
(E)-3-(4-hydroxyphenyl)prop-2-enoic acid
Molecular structure of (E)-3-(4-hydroxyphenyl)prop-2-enoic acid
3-methoxy-2-benzofuran-1(3~H)-one
Molecular structure of 3-methoxy-2-benzofuran-1(3H)-one
7-methoxy-3(2~H)-benzofuranone
Molecular structure of 7-methoxy-3(2H)-benzofuranone
2-methyl-1,3-benzodioxole-5-carbaldehyde
Molecular structure of 2-methyl-1,3-benzodioxole-5-carbaldehyde
3',4'-(methylenedioxy)acetophenone
Molecular structure of 3',4'-(methylenedioxy)acetophenone
methyl 2-formylbenzoate
Molecular structure of methyl 2-formylbenzoate
methyl 3-formylbenzoate
Molecular structure of methyl 3-formylbenzoate
methyl 4-formylbenzoate
Molecular structure of methyl 4-formylbenzoate
methyl 2-oxo-2-phenylacetate
Molecular structure of methyl 2-oxo-2-phenylacetate
cis-5-norbornene-exo-2,3-dicarboxylic anhydride
Molecular structure of cis-5-norbornene-exo-2,3-dicarboxylic anhydride
(Z)-3-phenoxypropenoic acid
Molecular structure of (Z)-3-phenoxypropenoic acid
phenylpyruvic acid
Molecular structure of phenylpyruvic acid