4-amino-2-chlorobenzoic acid


4-amino-2-chlorobenzoic acid; 2-chloro-4-aminobenzoic acid
Links:📖 PubMed
CAS:[2457-76-3]
Formula:C7H6ClNO2; 171.58 g/mol
InChiKey:MBDUKNCPOPMRJQ-UHFFFAOYSA-N
SMILES:Nc1ccc(C(O)=O)c(Cl)c1
Molecular structure of 4-amino-2-chlorobenzoic acid
Melting point:211 °C
Log10 partition octanol / water:1.33

Isomers

2-amino-3-chlorobenzoic acid
Molecular structure of 2-amino-3-chlorobenzoic acid
2-amino-4-chlorobenzoic acid
Molecular structure of 2-amino-4-chlorobenzoic acid
2-amino-5-chlorobenzoic acid
Molecular structure of 2-amino-5-chlorobenzoic acid
2-amino-6-chlorobenzoic acid
Molecular structure of 2-amino-6-chlorobenzoic acid
3-amino-2-chlorobenzoic acid
Molecular structure of 3-amino-2-chlorobenzoic acid
3-amino-4-chlorobenzoic acid
Molecular structure of 3-amino-4-chlorobenzoic acid
4-amino-2-chlorobenzoic acid
Molecular structure of 4-amino-2-chlorobenzoic acid
4-amino-3-chlorobenzoic acid
Molecular structure of 4-amino-3-chlorobenzoic acid
5-amino-2-chlorobenzoic acid
Molecular structure of 5-amino-2-chlorobenzoic acid
3-chloro-4-aminobenzoic acid
Molecular structure of 3-chloro-4-aminobenzoic acid
5-chloro-2-hydroxybenzamide
Molecular structure of 5-chloro-2-hydroxybenzamide
6-chloro-2-methoxypyridine-3-carboxaldehyde
Molecular structure of 6-chloro-2-methoxypyridine-3-carboxaldehyde
2-chloro-6-methylnicotinic acid
Molecular structure of 2-chloro-6-methylnicotinic acid
1-chloro-3-methyl-5-nitrobenzene
Molecular structure of 1-chloro-3-methyl-5-nitrobenzene
2-chloro-1-methyl-3-nitrobenzene
Molecular structure of 2-chloro-1-methyl-3-nitrobenzene
2-chloro-1-methyl-4-nitrobenzene
Molecular structure of 2-chloro-1-methyl-4-nitrobenzene
2-chloro-4-methyl-1-nitrobenzene
Molecular structure of 2-chloro-4-methyl-1-nitrobenzene
4-chloro-2-methyl-1-nitrobenzene
Molecular structure of 4-chloro-2-methyl-1-nitrobenzene
2-chloro-6-methylpyridine-4-carboxylic acid
Molecular structure of 2-chloro-6-methylpyridine-4-carboxylic acid
2-chloro-5-nitrotoluene
Molecular structure of 2-chloro-5-nitrotoluene
2-chloro-6-nitrotoluene
Molecular structure of 2-chloro-6-nitrotoluene
4-chloro-2-nitrotoluene
Molecular structure of 4-chloro-2-nitrotoluene
4-chloro-3-nitrotoluene
Molecular structure of 4-chloro-3-nitrotoluene
2-chloropyridine-4-acetic acid
Molecular structure of 2-chloropyridine-4-acetic acid
6-chloro-3-pyridineacetic acid
Molecular structure of 6-chloro-3-pyridineacetic acid
methyl 2-chloropyridine-3-carboxylate
Molecular structure of methyl 2-chloropyridine-3-carboxylate
methyl 2-chloropyridine-4-carboxylate
Molecular structure of methyl 2-chloropyridine-4-carboxylate
methyl 6-chloropyridine-3-carboxylate
Molecular structure of methyl 6-chloropyridine-3-carboxylate
2-nitrobenzyl chloride
Molecular structure of 2-nitrobenzyl chloride
3-nitrobenzyl chloride
Molecular structure of 3-nitrobenzyl chloride
4-nitrobenzyl chloride
Molecular structure of 4-nitrobenzyl chloride