4-chlorotrifluoromethylbenzene


p-chlorobenzotrifluoride; 4-chlorobenzotrifluoride; p-chloro(trifluoromethyl)benzene; 1-chloro-4-(trifluoromethyl)benzene; 4-chlorotrifluoromethylbenzene; 4-(trifluoromethyl)chlorobenzene
Links:📏 NIST, 📖 PubMed
CAS:[98-56-6]
Formula:C7H4ClF3; 180.56 g/mol
InChiKey:QULYNCCPRWKEMF-UHFFFAOYSA-N
SMILES:FC(F)(F)c1ccc(Cl)cc1
Molecular structure of 4-chlorotrifluoromethylbenzene
Density:1.341 g/mL
Molar volume:134.6 mL/mol
Refractive index:1.446
Molecular refractive power:35.91 mL/mol
Dipole moment:1.58 D
Melting point:-36 °C
Boiling point:139 °C
Evaporation rate (ether):13.4
Evaporation rate (butyl acetate):0.9
Hansen solubility parameter:δd: 18.0 (cal/ml)^0.5   δp: 5.9 (cal/ml)^0.5   δh: 3.9 (cal/ml)^0.5
Kauri butanol value:64

Isomers

2-chlorotrifluoromethylbenzene
Molecular structure of 2-chlorotrifluoromethylbenzene
3-chlorotrifluoromethylbenzene
Molecular structure of 3-chlorotrifluoromethylbenzene
4-chlorotrifluoromethylbenzene
Molecular structure of 4-chlorotrifluoromethylbenzene
2,4,5-trifluorobenzyl chloride
Molecular structure of 2,4,5-trifluorobenzyl chloride
3,4,5-trifluorobenzyl chloride
Molecular structure of 3,4,5-trifluorobenzyl chloride