4-cyanobenzoic acid


p-cyanobenzoic acid; 4-cyanobenzoic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[619-65-8]
Formula:C8H5NO2; 147.13 g/mol
InChiKey:ADCUEPOHPCPMCE-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(cc1)C#N
Molecular structure of 4-cyanobenzoic acid
Melting point:219 °C
Log10 partition octanol / water:1.45

Isomers

agrocybin
Molecular structure of agrocybin
1,3-benzodioxole-5-carbonitrile
Molecular structure of 1,3-benzodioxole-5-carbonitrile
benzoyl isocyanate
Molecular structure of benzoyl isocyanate
2-cyanobenzoic acid
Molecular structure of 2-cyanobenzoic acid
3-cyanobenzoic acid
Molecular structure of 3-cyanobenzoic acid
4-cyanobenzoic acid
Molecular structure of 4-cyanobenzoic acid
1-ethynyl-4-nitrobenzene
Molecular structure of 1-ethynyl-4-nitrobenzene
3-hydroxy-2-oxoindole
Molecular structure of 3-hydroxy-2-oxoindole
1H-indole-2,3-dione
Molecular structure of 1H-indole-2,3-dione
phthalimide
Molecular structure of phthalimide