4-ethylphenoxyacetic acid


4-ethylphenoxyacetic acid
CAS:[24431-27-4]
Formula:C10H12O3; 180.20 g/mol
InChiKey:WVELHLIHMYYZAT-UHFFFAOYSA-N
SMILES:CCc1ccc(OCC(O)=O)cc1
Molecular structure of 4-ethylphenoxyacetic acid
Melting point:93 °C

Isomers

cis-1,3-O-benzylideneglycerol
Molecular structure of cis-1,3-O-benzylideneglycerol
benzyl lactate
Molecular structure of benzyl lactate
(R)-(+)-2-(benzyloxy)propionic acid
Molecular structure of (R)-(+)-2-(benzyloxy)propionic acid
3',4'-dimethoxyacetophenone
Molecular structure of 3',4'-dimethoxyacetophenone
3',5'-dimethoxyacetophenone
Molecular structure of 3',5'-dimethoxyacetophenone
2,4-dimethoxy-3-methylbenzaldehyde
Molecular structure of 2,4-dimethoxy-3-methylbenzaldehyde
2,4-dimethoxy-6-methylbenzaldehyde
Molecular structure of 2,4-dimethoxy-6-methylbenzaldehyde
2,6-dimethoxy-4-methylbenzaldehyde
Molecular structure of 2,6-dimethoxy-4-methylbenzaldehyde
1-(2,4-dimethoxyphenyl)ethanone
Molecular structure of 1-(2,4-dimethoxyphenyl)ethanone
1-(2,5-dimethoxyphenyl)ethanone
Molecular structure of 1-(2,5-dimethoxyphenyl)ethanone
1-(2,6-dimethoxyphenyl)ethanone
Molecular structure of 1-(2,6-dimethoxyphenyl)ethanone
1-(3,4-dimethoxyphenyl)ethanone
Molecular structure of 1-(3,4-dimethoxyphenyl)ethanone
3,5-dimethyl-4-methoxybenzoic acid
Molecular structure of 3,5-dimethyl-4-methoxybenzoic acid
2,3-dimethylphenoxyacetic acid
Molecular structure of 2,3-dimethylphenoxyacetic acid
2,4-dimethylphenoxyacetic acid
Molecular structure of 2,4-dimethylphenoxyacetic acid
2,5-dimethylphenoxyacetic acid
Molecular structure of 2,5-dimethylphenoxyacetic acid
2,6-dimethylphenoxyacetic acid
Molecular structure of 2,6-dimethylphenoxyacetic acid
3,4-dimethylphenoxyacetic acid
Molecular structure of 3,4-dimethylphenoxyacetic acid
(3,5-dimethylphenoxy)acetic acid
Molecular structure of (3,5-dimethylphenoxy)acetic acid
4'-ethoxy-2'-hydroxyacetophenone
Molecular structure of 4'-ethoxy-2'-hydroxyacetophenone
5'-ethoxy-2'-hydroxyacetophenone
Molecular structure of 5'-ethoxy-2'-hydroxyacetophenone
2-ethoxy-3-methoxybenzaldehyde
Molecular structure of 2-ethoxy-3-methoxybenzaldehyde
3-ethoxy-4-methoxybenzaldehyde
Molecular structure of 3-ethoxy-4-methoxybenzaldehyde
4-ethoxy-3-methoxybenzaldehyde
Molecular structure of 4-ethoxy-3-methoxybenzaldehyde
2-ethoxyphenyl acetate
Molecular structure of 2-ethoxyphenyl acetate
3-ethoxyphenyl acetate
Molecular structure of 3-ethoxyphenyl acetate
4-ethoxyphenyl acetate
Molecular structure of 4-ethoxyphenyl acetate
4-ethoxyphenylacetic acid
Molecular structure of 4-ethoxyphenylacetic acid
ethyl (R)-2-hydroxy-2-phenylacetate
Molecular structure of ethyl (R)-2-hydroxy-2-phenylacetate
ethyl (S)-2-hydroxy-2-phenylacetate
Molecular structure of ethyl (S)-2-hydroxy-2-phenylacetate
ethyl 2-hydroxy-2-phenylacetate
Molecular structure of ethyl 2-hydroxy-2-phenylacetate
ethyl 4-hydroxyphenylacetate
Molecular structure of ethyl 4-hydroxyphenylacetate
ethyl 2-methoxybenzoate
Molecular structure of ethyl 2-methoxybenzoate
ethyl 3-methoxybenzoate
Molecular structure of ethyl 3-methoxybenzoate
ethyl 4-methoxybenzoate
Molecular structure of ethyl 4-methoxybenzoate
ethyl 5-methylsalicylate
Molecular structure of ethyl 5-methylsalicylate
ethyl phenoxyacetate
Molecular structure of ethyl phenoxyacetate
2-(2-ethylphenoxy)acetic acid
Molecular structure of 2-(2-ethylphenoxy)acetic acid
3-ethylphenoxyacetic acid
Molecular structure of 3-ethylphenoxyacetic acid
4-ethylphenoxyacetic acid
Molecular structure of 4-ethylphenoxyacetic acid
glycidyl 4-methoxyphenyl ether
Molecular structure of glycidyl 4-methoxyphenyl ether
3-hydroxy-4,5-dimethylphenylacetic acid
Molecular structure of 3-hydroxy-4,5-dimethylphenylacetic acid
3-hydroxy-4,6-dimethylphenylacetic acid
Molecular structure of 3-hydroxy-4,6-dimethylphenylacetic acid
4-hydroxy-1-(4-hydroxyphenyl)-1-butanone
Molecular structure of 4-hydroxy-1-(4-hydroxyphenyl)-1-butanone
2-hydroxy-3-isopropylbenzoic acid
Molecular structure of 2-hydroxy-3-isopropylbenzoic acid
4-hydroxy-3-methoxyphenylacetone
Molecular structure of 4-hydroxy-3-methoxyphenylacetone
1-(2-hydroxy-4-methoxyphenyl)propan-1-one
Molecular structure of 1-(2-hydroxy-4-methoxyphenyl)propan-1-one
4-(4-hydroxyphenyl)butanoic acid
Molecular structure of 4-(4-hydroxyphenyl)butanoic acid
(R)-2-hydroxy-4-phenylbutyric acid
Molecular structure of (R)-2-hydroxy-4-phenylbutyric acid
2-hydroxy-1-phenylethyl acetate
Molecular structure of 2-hydroxy-1-phenylethyl acetate
4-(3-hydroxyprop-1-enyl)-2-methoxyphenol
Molecular structure of 4-(3-hydroxyprop-1-enyl)-2-methoxyphenol
3-hydroxypropyl benzoate
Molecular structure of 3-hydroxypropyl benzoate
2-isopropoxybenzoic acid
Molecular structure of 2-isopropoxybenzoic acid
3-isopropoxybenzoic acid
Molecular structure of 3-isopropoxybenzoic acid
4-isopropoxybenzoic acid
Molecular structure of 4-isopropoxybenzoic acid
isopropyl 4-hydroxybenzoate
Molecular structure of isopropyl 4-hydroxybenzoate
4-methoxybenzyl acetate
Molecular structure of 4-methoxybenzyl acetate
4-methoxyphenylmethyl acetate
Molecular structure of 4-methoxyphenylmethyl acetate
2-(2-methoxyphenyl)propanoic acid
Molecular structure of 2-(2-methoxyphenyl)propanoic acid
2-(3-methoxyphenyl)propanoic acid
Molecular structure of 2-(3-methoxyphenyl)propanoic acid
2-(4-methoxyphenyl)propanoic acid
Molecular structure of 2-(4-methoxyphenyl)propanoic acid
3-methoxy-3-phenylpropanoic acid
Molecular structure of 3-methoxy-3-phenylpropanoic acid
3-(2-methoxyphenyl)propionic acid
Molecular structure of 3-(2-methoxyphenyl)propionic acid
3-(3-methoxyphenyl)propionic acid
Molecular structure of 3-(3-methoxyphenyl)propionic acid
3-(4-methoxyphenyl)propionic acid
Molecular structure of 3-(4-methoxyphenyl)propionic acid
methyl 3-ethoxybenzoate
Molecular structure of methyl 3-ethoxybenzoate
methyl 4-ethoxybenzoate
Molecular structure of methyl 4-ethoxybenzoate
methyl 4-(1-hydroxyethyl)benzoate
Molecular structure of methyl 4-(1-hydroxyethyl)benzoate
methyl (2S)-2-hydroxy-3-phenylpropanoate
Molecular structure of methyl (2S)-2-hydroxy-3-phenylpropanoate
methyl 3-(2-hydroxyphenyl)propanoate
Molecular structure of methyl 3-(2-hydroxyphenyl)propanoate
methyl 3-(4-hydroxyphenyl)propionate
Molecular structure of methyl 3-(4-hydroxyphenyl)propionate
methyl 2-methoxy-5-methylbenzoate
Molecular structure of methyl 2-methoxy-5-methylbenzoate
methyl 3-methoxy-4-methylbenzoate
Molecular structure of methyl 3-methoxy-4-methylbenzoate
methyl 4-methoxyphenylacetate
Molecular structure of methyl 4-methoxyphenylacetate
methyl 2-(2-methylphenoxy)acetate
Molecular structure of methyl 2-(2-methylphenoxy)acetate
2-methyl-2-(phenoxy)propanoic acid
Molecular structure of 2-methyl-2-(phenoxy)propanoic acid
3-(4-methylphenoxy)propionic acid
Molecular structure of 3-(4-methylphenoxy)propionic acid
4-phenoxybutanoic acid
Molecular structure of 4-phenoxybutanoic acid
2-phenoxybutyric acid
Molecular structure of 2-phenoxybutyric acid
2-phenoxyethyl acetate
Molecular structure of 2-phenoxyethyl acetate
phenylmethyl (2S)-2-hydroxypropanoate
Molecular structure of phenylmethyl (2S)-2-hydroxypropanoate
propan-2-yl 2-hydroxybenzoate
Molecular structure of propan-2-yl 2-hydroxybenzoate
2-propoxybenzoic acid
Molecular structure of 2-propoxybenzoic acid
3-propoxybenzoic acid
Molecular structure of 3-propoxybenzoic acid
4-propoxybenzoic acid
Molecular structure of 4-propoxybenzoic acid
propyl (E)-3-furan-2-ylprop-2-enoate
Molecular structure of propyl (E)-3-furan-2-ylprop-2-enoate
propyl 2-hydroxybenzoate
Molecular structure of propyl 2-hydroxybenzoate
propyl 4-hydroxybenzoate
Molecular structure of propyl 4-hydroxybenzoate