4-fluorophenoxyacetic acid


p-fluorophenoxyacetic acid; 4-fluorophenoxyacetic acid
Links:📏 NIST
CAS:[405-79-8]
Formula:C8H7FO3; 170.14 g/mol
InChiKey:ZBIULCVFFJJYTN-UHFFFAOYSA-N
SMILES:OC(=O)COc1ccc(F)cc1
Molecular structure of 4-fluorophenoxyacetic acid
Melting point:105 °C
Log10 partition octanol / water:1.64

Isomers

3-fluoro-4-hydroxy-5-methoxybenzaldehyde
Molecular structure of 3-fluoro-4-hydroxy-5-methoxybenzaldehyde
2-fluoro-4-(hydroxymethyl)benzoic acid
Molecular structure of 2-fluoro-4-(hydroxymethyl)benzoic acid
3-fluoro-4-hydroxyphenylacetic acid
Molecular structure of 3-fluoro-4-hydroxyphenylacetic acid
2-fluoro-4-methoxybenzoic acid
Molecular structure of 2-fluoro-4-methoxybenzoic acid
2-fluoro-6-methoxybenzoic acid
Molecular structure of 2-fluoro-6-methoxybenzoic acid
3-fluoro-2-methoxybenzoic acid
Molecular structure of 3-fluoro-2-methoxybenzoic acid
3-fluoro-4-methoxybenzoic acid
Molecular structure of 3-fluoro-4-methoxybenzoic acid
4-fluoro-2-methoxybenzoic acid
Molecular structure of 4-fluoro-2-methoxybenzoic acid
4-fluoro-3-methoxybenzoic acid
Molecular structure of 4-fluoro-3-methoxybenzoic acid
5-fluoro-2-methoxybenzoic acid
Molecular structure of 5-fluoro-2-methoxybenzoic acid
2-fluorophenoxyacetic acid
Molecular structure of 2-fluorophenoxyacetic acid
3-fluorophenoxyacetic acid
Molecular structure of 3-fluorophenoxyacetic acid
4-fluorophenoxyacetic acid
Molecular structure of 4-fluorophenoxyacetic acid
2-(2-fluorophenyl)-2-hydroxyacetic acid
Molecular structure of 2-(2-fluorophenyl)-2-hydroxyacetic acid
2-(4-fluorophenyl)-2-hydroxyacetic acid
Molecular structure of 2-(4-fluorophenyl)-2-hydroxyacetic acid
3-fluorophenyl-2-hydroxyacetic acid
Molecular structure of 3-fluorophenyl-2-hydroxyacetic acid
methyl 4-fluoro-3-hydroxybenzoate
Molecular structure of methyl 4-fluoro-3-hydroxybenzoate