4-formylbenzoic acid


4-carboxybenzaldehyde; p-formylbenzoic acid; 4-formylbenzoic acid
Links:🕷 ChemSpider, 📖 PubMed
CAS:[619-66-9]
Formula:C8H6O3; 150.13 g/mol
InChiKey:GOUHYARYYWKXHS-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(C=O)cc1
Molecular structure of 4-formylbenzoic acid
Melting point:245 °C
Log10 partition octanol / water:1.76

Isomers

1,3-benzodioxole-4-carbaldehyde
Molecular structure of 1,3-benzodioxole-4-carbaldehyde
2,3-dihydro-1,4-benzodioxin-2-one
Molecular structure of 2,3-dihydro-1,4-benzodioxin-2-one
2-formylbenzoic acid
Molecular structure of 2-formylbenzoic acid
3-formylbenzoic acid
Molecular structure of 3-formylbenzoic acid
4-formylbenzoic acid
Molecular structure of 4-formylbenzoic acid
(3R)-3-hydroxy-3H-2-benzofuran-1-one
Molecular structure of (3R)-3-hydroxy-3H-2-benzofuran-1-one
5-hydroxy-2(3~H)-benzofuranone
Molecular structure of 5-hydroxy-2(3H)-benzofuranone
6-hydroxy-2H-benzofuran-3-one
Molecular structure of 6-hydroxy-2H-benzofuran-3-one
3,4-methylenedioxybenzaldehyde
Molecular structure of 3,4-methylenedioxybenzaldehyde
2-oxo-2-phenylacetic acid
Molecular structure of 2-oxo-2-phenylacetic acid