4-isopropylphenoxyacetic acid


4-isopropylphenoxyacetic acid
CAS:[1643-16-9]
Formula:C11H14O3; 194.23 g/mol
InChiKey:FPVCSFOUVDLTDG-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(OCC(O)=O)cc1
Molecular structure of 4-isopropylphenoxyacetic acid
Melting point:86 °C
Log10 partition octanol / water:2.69

Isomers

4-allyl-2,6-dimethoxyphenol
Molecular structure of 4-allyl-2,6-dimethoxyphenol
3-butoxybenzoic acid
Molecular structure of 3-butoxybenzoic acid
4-butoxybenzoic acid
Molecular structure of 4-butoxybenzoic acid
butyl (E)-3-furan-3-ylprop-2-enoate
Molecular structure of butyl (E)-3-furan-3-ylprop-2-enoate
butyl 2-hydroxybenzoate
Molecular structure of butyl 2-hydroxybenzoate
butyl 4-hydroxybenzoate
Molecular structure of butyl 4-hydroxybenzoate
tert-butyl peroxybenzoate
Molecular structure of tert-butyl peroxybenzoate
tert-butyl phenyl carbonate
Molecular structure of tert-butyl phenyl carbonate
3,4-diethoxybenzaldehyde
Molecular structure of 3,4-diethoxybenzaldehyde
3,4-dimethoxyphenylacetone
Molecular structure of 3,4-dimethoxyphenylacetone
2',4'-dimethoxypropiophenone
Molecular structure of 2',4'-dimethoxypropiophenone
4'-ethoxy-2'-hydroxy-3'-methylacetophenone
Molecular structure of 4'-ethoxy-2'-hydroxy-3'-methylacetophenone
ethyl 2-(benzyloxy)acetate
Molecular structure of ethyl 2-(benzyloxy)acetate
ethyl 2-ethoxybenzoate
Molecular structure of ethyl 2-ethoxybenzoate
ethyl 4-ethoxybenzoate
Molecular structure of ethyl 4-ethoxybenzoate
ethyl 3-hydroxy-3-phenylpropionate
Molecular structure of ethyl 3-hydroxy-3-phenylpropionate
ethyl (2-methylphenoxy)acetate
Molecular structure of ethyl (2-methylphenoxy)acetate
ethyl 3-(phenoxy)propanoate
Molecular structure of ethyl 3-(phenoxy)propanoate
2-hydroxy-6-isopropyl-3-methylbenzoic acid
Molecular structure of 2-hydroxy-6-isopropyl-3-methylbenzoic acid
4-(4-hydroxy-3-methoxyphenyl)-2-butanone
Molecular structure of 4-(4-hydroxy-3-methoxyphenyl)-2-butanone
1-hydroxymethylperoxytetraline
Molecular structure of 1-hydroxymethylperoxytetraline
2-(4'-hydroxy-3'-methylphenyl)butanoic acid
Molecular structure of 2-(4'-hydroxy-3'-methylphenyl)butanoic acid
2-(2'-hydroxy-4'-methylphenyl)-2-methylpropanoic acid
Molecular structure of 2-(2'-hydroxy-4'-methylphenyl)-2-methylpropanoic acid
2-(2-hydroxy-2-methylpropanoyl)-4-methylphenol
Molecular structure of 2-(2-hydroxy-2-methylpropanoyl)-4-methylphenol
2-hydroxy-6-methyl-3-propan-2-ylbenzoic acid
Molecular structure of 2-hydroxy-6-methyl-3-propan-2-ylbenzoic acid
2-(4-hydroxyphenyl)-3-methylbutanoic acid
Molecular structure of 2-(4-hydroxyphenyl)-3-methylbutanoic acid
5-(4-hydroxyphenyl)pentanoic acid
Molecular structure of 5-(4-hydroxyphenyl)pentanoic acid
2-(2-hydroxypropanoyl)-4-methoxy-1-methylbenzene
Molecular structure of 2-(2-hydroxypropanoyl)-4-methoxy-1-methylbenzene
2-isopropylphenoxyacetic acid
Molecular structure of 2-isopropylphenoxyacetic acid
3-isopropylphenoxyacetic acid
Molecular structure of 3-isopropylphenoxyacetic acid
4-isopropylphenoxyacetic acid
Molecular structure of 4-isopropylphenoxyacetic acid
4-methoxybenzyl propanoate
Molecular structure of 4-methoxybenzyl propanoate
4-(4-methoxyphenyl)butanoic acid
Molecular structure of 4-(4-methoxyphenyl)butanoic acid
methyl 3-(2-methoxyphenyl)propanoate
Molecular structure of methyl 3-(2-methoxyphenyl)propanoate
methyl 3-(4-methoxyphenyl)propionate
Molecular structure of methyl 3-(4-methoxyphenyl)propionate
2-methylpropyl 2-hydroxybenzoate
Molecular structure of 2-methylpropyl 2-hydroxybenzoate
phenoxyethyl propionate
Molecular structure of phenoxyethyl propionate
3-propylphenoxyacetic acid
Molecular structure of 3-propylphenoxyacetic acid