4-phenylphenol


biphenyl-4-ol; p-hydroxybiphenyl; p-hydroxydiphenyl; p-phenylphenol; 4-phenylphenol
Links:📏 NIST, 📖 PubMed
CAS:[92-69-3]
Formula:C12H10O; 170.21 g/mol
InChiKey:YXVFYQXJAXKLAK-UHFFFAOYSA-N
SMILES:Oc1ccc(cc1)c2ccccc2
Molecular structure of 4-phenylphenol
Melting point:165 °C
Boiling point:306 °C
Log10 partition octanol / water:3.37

Isomers

1-acetylazulene
Molecular structure of 1-acetylazulene
1-acetylnaphthalene
Molecular structure of 1-acetylnaphthalene
2-acetylnaphthalene
Molecular structure of 2-acetylnaphthalene
1,2-dihydroacenaphthylen-1-ol
Molecular structure of 1,2-dihydroacenaphthylen-1-ol
diphenyl ether
Molecular structure of diphenyl ether
1-formyl-2-methylnaphthalene
Molecular structure of 1-formyl-2-methylnaphthalene
8-methylbenzo[7]annulen-7-one
Molecular structure of 8-methylbenzo[7]annulen-7-one
4-methyl-1-naphthaldehyde
Molecular structure of 4-methyl-1-naphthaldehyde
2-phenylphenol
Molecular structure of 2-phenylphenol
3-phenylphenol
Molecular structure of 3-phenylphenol
4-phenylphenol
Molecular structure of 4-phenylphenol