4-tert-butylphenoxyacetic acid


4-tert-butylphenoxyacetic acid
CAS:[1798-04-5]
Formula:C12H16O3; 208.26 g/mol
InChiKey:FBIGAJNVRFKBJL-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(OCC(O)=O)cc1
Molecular structure of 4-tert-butylphenoxyacetic acid
Melting point:96 °C

Isomers

amyl trans-β-furylacrylate
Molecular structure of amyl trans-b-furylacrylate
2-(2-butan-2-ylphenoxy)acetic acid
Molecular structure of 2-(2-butan-2-ylphenoxy)acetic acid
2-(4-butan-2-ylphenoxy)acetic acid
Molecular structure of 2-(4-butan-2-ylphenoxy)acetic acid
4-(tert-butoxymethyl)benzoic acid
Molecular structure of 4-(tert-butoxymethyl)benzoic acid
5-tert-butyl-2-methoxybenzoic acid
Molecular structure of 5-tert-butyl-2-methoxybenzoic acid
2-(2-tert-butylphenoxy)acetic acid
Molecular structure of 2-(2-tert-butylphenoxy)acetic acid
2-(3-butylphenoxy)acetic acid
Molecular structure of 2-(3-butylphenoxy)acetic acid
2-(3-tert-butylphenoxy)acetic acid
Molecular structure of 2-(3-tert-butylphenoxy)acetic acid
4-tert-butylphenoxyacetic acid
Molecular structure of 4-tert-butylphenoxyacetic acid
2,2-diethoxyacetophenone
Molecular structure of 2,2-diethoxyacetophenone
4-(diethoxymethyl)benzaldehyde
Molecular structure of 4-(diethoxymethyl)benzaldehyde
2,5-dimethoxy-3,4,6-trimethylbenzaldehyde
Molecular structure of 2,5-dimethoxy-3,4,6-trimethylbenzaldehyde
ethyl 4-ethoxyphenylacetate
Molecular structure of ethyl 4-ethoxyphenylacetate
ethyl (R)-(-)-2-hydroxy-4-phenylbutyrate
Molecular structure of ethyl (R)-(-)-2-hydroxy-4-phenylbutyrate
ethyl 3-(4-methoxyphenyl)propanoate
Molecular structure of ethyl 3-(4-methoxyphenyl)propanoate
ethyl 3-methyl-4-ethoxybenzoate
Molecular structure of ethyl 3-methyl-4-ethoxybenzoate
ethyl 4-(phenoxy)butanoate
Molecular structure of ethyl 4-(phenoxy)butanoate
isoamyl-4-hydroxybenzoate
Molecular structure of isoamyl-4-hydroxybenzoate
2-methoxyphenyl pentanoate
Molecular structure of 2-methoxyphenyl pentanoate
methyl 4-n-butoxybenzoate
Molecular structure of methyl 4-n-butoxybenzoate
3-methylbutyl salicylate
Molecular structure of 3-methylbutyl salicylate
pentyl 2-hydroxybenzoate
Molecular structure of pentyl 2-hydroxybenzoate
pentyl 4-hydroxybenzoate
Molecular structure of pentyl 4-hydroxybenzoate
4-pentyloxybenzoic acid
Molecular structure of 4-pentyloxybenzoic acid
2-phenoxyethyl 2-methylpropanoate
Molecular structure of 2-phenoxyethyl 2-methylpropanoate
1,2,4-trimethoxy-5-[(E)-prop-1-enyl]benzene
Molecular structure of 1,2,4-trimethoxy-5-[(E)-prop-1-enyl]benzene
1,2,4-trimethoxy-5-[(Z)-prop-1-enyl]benzene
Molecular structure of 1,2,4-trimethoxy-5-[(Z)-prop-1-enyl]benzene
(2E)-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-ylidene)ethanoic acid
Molecular structure of (2E)-(4,7,7-trimethyl-3-oxobicyclo[2.2.1]hept-2-ylidene)ethanoic acid