D-glucose


dextrose; D(+)-glucose; D-(+)-glucose; D-glucose
Links:🌍 Wikipedia,
📖Houben-Weyl, 2. Band (Glucose); p. 28, 202, 423, 498, 504, 871, 909, 984
MeSH:Food Additives; Food Additives
CAS:[50-99-7]
Formula:C6H12O6; 180.16 g/mol
InChiKey:GZCGUPFRVQAUEE-SLPGGIOYSA-N
SMILES:OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O
Molecular structure of D-glucose
Density:1.540 g/mL
Molar volume:117.0 mL/mol
Melting point:146 °C
Log10 partition octanol / water:-3.24

Isomers

allo-inositol
Molecular structure of allo-inositol
α-D-allopyranose
Molecular structure of a-D-allopyranose
β-D-allopyranose
Molecular structure of b-D-allopyranose
α-D-altropyranose
Molecular structure of a-D-altropyranose
β-D-altropyranose
Molecular structure of b-D-altropyranose
2,5-bis(hydroxymethyl)-1,4-dioxane-2,5-diol
Molecular structure of 2,5-bis(hydroxymethyl)-1,4-dioxane-2,5-diol
D-(+)-chiro-inositol
Molecular structure of D-(+)-chiro-inositol
L-chiro-inositol
Molecular structure of L-chiro-inositol
epi-inositol
Molecular structure of epi-inositol
β-D-fructofuranose
Molecular structure of b-D-fructofuranose
fructose
Molecular structure of fructose
α-D-galactopyranose
Molecular structure of a-D-galactopyranose
β-D-galactopyranose
Molecular structure of b-D-galactopyranose
α-D-glucofuranose
Molecular structure of a-D-glucofuranose
α-D-glucopyranose
Molecular structure of a-D-glucopyranose
β-D-glucopyranose
Molecular structure of b-D-glucopyranose
D-glucose
Molecular structure of D-glucose
cis-inositol
Molecular structure of cis-inositol
levoglucose
Molecular structure of levoglucose
α-D-mannopyranose
Molecular structure of a-D-mannopyranose
β-D-mannopyranose
Molecular structure of b-D-mannopyranose
muco-inositol
Molecular structure of muco-inositol
myo-inositol
Molecular structure of myo-inositol
neo-inositol
Molecular structure of neo-inositol
scyllo-inositol
Molecular structure of scyllo-inositol