L-carnitine


carnitine; L-carnitine; L-carnitine inner salt; (3R)-3-hydroxy-4-trimethylammoniobutanoate
Links:🕷 ChemSpider, 📖 PubMed
CAS:[541-15-1]
Formula:C7H15NO3; 161.20 g/mol
InChiKey:PHIQHXFUZVPYII-ZCFIWIBFSA-N
SMILES:C[N+](C)(C)C[C@H](O)CC([O-])=O
Molecular structure of L-carnitine
Density:0.640 g/mL
Molar volume:251.9 mL/mol
Melting point:197 °C

Isomers

2-butoxyethyl carbamate
Molecular structure of 2-butoxyethyl carbamate
tert-butyl N-(2-hydroxyethyl)carbamate
Molecular structure of tert-butyl N-(2-hydroxyethyl)carbamate
L-carnitine
Molecular structure of L-carnitine
deoxyvalidamine
Molecular structure of deoxyvalidamine
2-methyl-4-nitro-3-hexanol
Molecular structure of 2-methyl-4-nitro-3-hexanol
3-morpholino-1,2-propanediol
Molecular structure of 3-morpholino-1,2-propanediol