L-glutamine


(2S)-2-amino-4-carbamoylbutanoic acid; (2S)-2,5-diamino-5-oxopentanoic acid; glutamine; L-glutamine
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[56-85-9]
US Adopted Name:glutamine
Formula:C5H10N2O3; 146.15 g/mol
InChiKey:ZDXPYRJPNDTMRX-VKHMYHEASA-N
SMILES:O=C(O)C(N)CCC(=O)N
Molecular structure of L-glutamine
Density:1.470 g/mL
Molar volume:99.4 mL/mol
Melting point:185 °C
Log10 partition octanol / water:-3.64

Isomers

N-carbamoyl-DL-2-aminobutanoic acid
Molecular structure of N-carbamoyl-DL-2-aminobutanoic acid
D-glutamine
Molecular structure of D-glutamine
L-glutamine
Molecular structure of L-glutamine
glycylalanine
Molecular structure of glycylalanine
2-methyl-2-ureidopropanoic acid
Molecular structure of 2-methyl-2-ureidopropanoic acid
N-nitrosoethylurethane
Molecular structure of N-nitrosoethylurethane